Herbarin
Internal ID | 75a5f5fa-9447-4e86-95a4-df246c50ea08 |
Taxonomy | Phenylpropanoids and polyketides > Isochromanequinones > Benzoisochromanequinones |
IUPAC Name | 3-hydroxy-7,9-dimethoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-5,10-dione |
SMILES (Canonical) | CC1(CC2=C(CO1)C(=O)C3=C(C2=O)C=C(C=C3OC)OC)O |
SMILES (Isomeric) | CC1(CC2=C(CO1)C(=O)C3=C(C2=O)C=C(C=C3OC)OC)O |
InChI | InChI=1S/C16H16O6/c1-16(19)6-10-11(7-22-16)15(18)13-9(14(10)17)4-8(20-2)5-12(13)21-3/h4-5,19H,6-7H2,1-3H3 |
InChI Key | MQWLANHTCHDMAR-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C16H16O6 |
Molecular Weight | 304.29 g/mol |
Exact Mass | 304.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 0.80 |
36379-67-6 |
3-hydroxy-7,9-dimethoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-5,10-dione |
3-Hydroxy-7,9-dimethoxy-3-methyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
DTXSID70957714 |
MFCD08274581 |
AKOS030213199 |
BS-1592 |
1H-Naphtho(2,3-c)pyran-5,10-dione, 3,4-dihydro-3-hydroxy-7,9-dimethoxy-3-methyl- |
3-Hydroxy-7,9-dimethoxy-3-methyl-3,4-dihydro-1H-naphtho[2,3-c]pyran-5,10-dione |
![2D Structure of Herbarin 2D Structure of Herbarin](https://plantaedb.com/storage/docs/compounds/2023/11/herbarin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.44% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.12% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.30% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.90% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.09% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.40% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.82% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.89% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.79% | 92.94% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.62% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.74% | 91.07% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.57% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.97% | 95.89% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.68% | 96.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.52% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.79% | 98.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.71% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum hainanense |
PubChem | 3084629 |
LOTUS | LTS0094033 |
wikiData | Q104986460 |