heptaprenylcycli-14E,18E-diene
| Internal ID | 2e2d6559-4757-4919-98e4-ec17826e8666 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
| IUPAC Name | 1-methyl-4-[(5Z,9E,13E)-6,10,14,18,22-pentamethyltricosa-1,5,9,13-tetraen-2-yl]cyclohexene |
| SMILES (Canonical) | CC1=CCC(CC1)C(=C)CCC=C(C)CCC=C(C)CCC=C(C)CCCC(C)CCCC(C)C |
| SMILES (Isomeric) | CC1=CCC(CC1)C(=C)CC/C=C(/C)\CC/C=C(\C)/CC/C=C(\C)/CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C35H60/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-34(8)35-26-24-33(7)25-27-35/h18,20,22,24,28-29,35H,8-17,19,21,23,25-27H2,1-7H3/b30-18+,31-20+,32-22- |
| InChI Key | WWHZMUGIEHEXJY-FBWDTQFLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H60 |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.469501914 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 13.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.53% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.91% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.82% | 93.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.54% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.29% | 90.71% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 89.05% | 92.51% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.02% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.40% | 97.21% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.15% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.51% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.16% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.89% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.84% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.40% | 99.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.97% | 93.18% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.49% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.55% | 97.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.19% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101575909 |
| LOTUS | LTS0111495 |
| wikiData | Q77373971 |