Heptaleno(2',1':4,5)benzo(1,2-d)(1,3)dioxole-4,6-dione, 7,8-dihydro-3,13-dimethoxy-
| Internal ID | 88375622-e1d5-4876-86da-cd0107a917aa |
| Taxonomy | Organoheterocyclic compounds > Benzodioxoles |
| IUPAC Name | 5,19-dimethoxy-15,17-dioxatetracyclo[10.7.0.02,8.014,18]nonadeca-1(19),2,4,7,12,14(18)-hexaene-6,9-dione |
| SMILES (Canonical) | COC1=CC=C2C(=CC1=O)C(=O)CCC3=CC4=C(C(=C32)OC)OCO4 |
| SMILES (Isomeric) | COC1=CC=C2C(=CC1=O)C(=O)CCC3=CC4=C(C(=C32)OC)OCO4 |
| InChI | InChI=1S/C19H16O6/c1-22-15-6-4-11-12(8-14(15)21)13(20)5-3-10-7-16-18(25-9-24-16)19(23-2)17(10)11/h4,6-8H,3,5,9H2,1-2H3 |
| InChI Key | QJLUHEJHRCZCRO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09468823 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | 2.20 |
| 129724-64-7 |
| DTXSID50156228 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.01% | 96.77% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.35% | 86.33% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 93.97% | 82.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.15% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.59% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.06% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.97% | 91.49% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 90.97% | 92.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.54% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.99% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.26% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.86% | 92.62% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.79% | 93.40% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.69% | 98.75% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.35% | 96.86% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.32% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.95% | 89.00% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.86% | 92.38% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.72% | 96.21% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.36% | 89.50% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.98% | 95.78% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.54% | 96.00% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.35% | 91.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.06% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Colchicum ritchiei |
| PubChem | 181423 |
| LOTUS | LTS0106303 |
| wikiData | Q83024264 |