Heptacosyl cyclohexanecarboxylate
Internal ID | 928f829b-8e9a-44e5-9011-c29dbef6c6de |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohol esters |
IUPAC Name | heptacosyl cyclohexanecarboxylate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)C1CCCCC1 |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)C1CCCCC1 |
InChI | InChI=1S/C34H66O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29-32-36-34(35)33-30-27-26-28-31-33/h33H,2-32H2,1H3 |
InChI Key | LTJIYIZESVZZKU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H66O2 |
Molecular Weight | 506.90 g/mol |
Exact Mass | 506.50628134 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 15.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.55% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.41% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.84% | 98.95% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 92.54% | 98.57% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.30% | 89.63% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.60% | 100.00% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 91.43% | 96.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.69% | 91.81% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.92% | 83.82% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.88% | 99.17% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.03% | 92.50% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 88.90% | 85.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.14% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.96% | 95.50% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 87.07% | 90.24% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.33% | 93.56% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 85.83% | 86.67% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.40% | 97.29% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.08% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.58% | 94.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.93% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.88% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tridax procumbens |
PubChem | 13991168 |
LOTUS | LTS0197240 |
wikiData | Q105156973 |