(1S,2R,3S,4R,5R,6S,8R,9S,10R,13R,14R,16S,17S,18R)-8-amino-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,14-triol
| Internal ID | 9da22939-e41f-4afc-b654-c451904a4e87 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
| IUPAC Name | (1S,2R,3S,4R,5R,6S,8R,9S,10R,13R,14R,16S,17S,18R)-8-amino-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,14-triol |
| SMILES (Canonical) | CCN1CC2(C(CC(C34C2C(C(C31)C5(CC(C6(CC4C5C6O)O)OC)N)OC)OC)O)COC |
| SMILES (Isomeric) | CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]5(C[C@@H]([C@]6(C[C@@H]4[C@@H]5[C@H]6O)O)OC)N)OC)OC)O)COC |
| InChI | InChI=1S/C25H42N2O7/c1-6-27-10-22(11-31-2)13(28)7-14(32-3)25-12-8-24(30)15(33-4)9-23(26,16(12)21(24)29)17(20(25)27)18(34-5)19(22)25/h12-21,28-30H,6-11,26H2,1-5H3/t12-,13-,14+,15+,16-,17+,18+,19-,20-,21-,22+,23-,24+,25+/m1/s1 |
| InChI Key | ZWUFSCXXMINYCW-DCQLVONUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H42N2O7 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.29920168 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | -1.80 |
| RefChem:922833 |
| (1S,2R,3S,4R,5R,6S,8R,9S,10R,13R,14R,16S,17S,18R)-8-amino-11-ethyl-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo(7.7.2.12,5.01,10.03,8.013,17)nonadecane-4,5,14-triol |
| 618456-73-8 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.70% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.47% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.24% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.55% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.90% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.70% | 92.94% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.66% | 95.58% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.24% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 87.51% | 87.16% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.50% | 95.89% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.26% | 97.28% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 84.17% | 92.38% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.98% | 97.53% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.44% | 90.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.21% | 96.90% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.84% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.88% | 94.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.87% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aconitum hemsleyanum |
| Duranta erecta |
| PubChem | 101239158 |
| NPASS | NPC116995 |
| LOTUS | LTS0102012 |
| wikiData | Q105385238 |