Heliannuol C
Internal ID | 1b64daf4-84ef-4071-ad40-634d02b3520b |
Taxonomy | Organoheterocyclic compounds > Benzoxepines |
IUPAC Name | 5-ethenyl-2,2,8-trimethyl-4,5-dihydro-3H-1-benzoxepine-3,7-diol |
SMILES (Canonical) | CC1=CC2=C(C=C1O)C(CC(C(O2)(C)C)O)C=C |
SMILES (Isomeric) | CC1=CC2=C(C=C1O)C(CC(C(O2)(C)C)O)C=C |
InChI | InChI=1S/C15H20O3/c1-5-10-7-14(17)15(3,4)18-13-6-9(2)12(16)8-11(10)13/h5-6,8,10,14,16-17H,1,7H2,2-4H3 |
InChI Key | DYXGWEYZDXILMS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H20O3 |
Molecular Weight | 248.32 g/mol |
Exact Mass | 248.14124450 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 2.90 |
(-)-Heliannuol C |
CHEBI:138769 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 90.27% | 90.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.31% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.95% | 93.40% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.31% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.72% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.58% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.93% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.56% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.09% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.72% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.31% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 82.36% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.02% | 86.33% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.37% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helianthus annuus |
PubChem | 131751670 |
LOTUS | LTS0080555 |
wikiData | Q104403109 |