CID 10680071
| Internal ID | 4e05de5c-8f6f-4793-8e8d-5312f8208f41 |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Amines > Tertiary amines > Trialkylamines |
| IUPAC Name | 3-(3-methylazecan-1-yl)propan-1-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H28N2/c1-13-8-5-3-2-4-6-10-15(12-13)11-7-9-14/h13H,2-12,14H2,1H3 |
| InChI Key | PPPRFIZNQYJYBX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.37 g/mol |
| Exact Mass | 212.225248902 g/mol |
| Topological Polar Surface Area (TPSA) | 29.30 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.66% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.26% | 96.09% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 94.51% | 95.27% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 93.82% | 93.90% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 92.32% | 86.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 92.06% | 98.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.57% | 98.95% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.99% | 93.18% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.59% | 95.50% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 90.45% | 96.67% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 90.14% | 94.78% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 90.08% | 96.25% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 89.39% | 98.33% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 88.59% | 99.29% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 87.64% | 97.64% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.50% | 97.09% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 86.52% | 83.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.51% | 82.69% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.26% | 95.17% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 86.02% | 90.71% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.59% | 99.18% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.95% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.71% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.52% | 90.24% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.88% | 92.94% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.43% | 80.71% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 82.40% | 98.57% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.34% | 98.46% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 82.00% | 95.61% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 81.82% | 100.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.73% | 92.50% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.63% | 95.36% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.08% | 90.24% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.06% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10680071 |
| LOTUS | LTS0126363 |
| wikiData | Q105212994 |