(6aR)-6,6a,9,10-Tetrahydro-2H,8H-(1,3)oxazino(3,2-a)pyrrolo(4,3,2-de)quinoline-2,3(4H)-dione
| Internal ID | bf6ad7b2-b622-4f9e-8c93-eb6ad48eef20 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Pyrroloquinolines > Pyrrolo[4,3,2-de]quinolines |
| IUPAC Name | (7R)-6-oxa-2,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16)-triene-13,14-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H12N2O3/c16-9-5-8-11-7(6-14-12(11)13(9)17)4-10-15(8)2-1-3-18-10/h5-6,10,14H,1-4H2/t10-/m1/s1 |
| InChI Key | GTVMGUBGOSWMOJ-SNVBAGLBSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08479225 g/mol |
| Topological Polar Surface Area (TPSA) | 62.40 Ų |
| XlogP | 0.60 |
| 151964-21-5 |
| 838N74Y28P |
| (6aR)-6,6a,9,10-Tetrahydro-2H,8H-(1,3)oxazino(3,2-a)pyrrolo(4,3,2-de)quinoline-2,3(4H)-dione |
| RefChem:1050668 |
| 6-oxa-2,11-diazatetracyclo(7.6.1.0^(2,7).0^(12,16))hexadeca-1(15),9,12(16)-triene-13,14-dione |
| (7R)-6-oxa-2,11-diazatetracyclo(7.6.1.02,7.012,16)hexadeca-1(15),9,12(16)-triene-13,14-dione |
| UNII-838N74Y28P |
| 2H,8H-(1,3)Oxazino(3,2-a)pyrrolo(4,3,2-de)quinoline-2,3(4H)-dione, 6,6a,9,10-tetrahydro-, (R)- |
| Haematopodine |
| orb2813854 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.24% | 98.95% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.68% | 93.40% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.96% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.43% | 93.99% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.24% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.65% | 89.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.20% | 96.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 90.14% | 80.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.69% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.52% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.37% | 91.11% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.27% | 93.03% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.19% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.54% | 98.59% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 88.42% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.32% | 95.89% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.17% | 80.96% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 85.06% | 81.14% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 84.85% | 96.39% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.31% | 96.67% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.10% | 95.62% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.59% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.21% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.96% | 94.66% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.33% | 83.10% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.27% | 94.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.07% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.55% | 90.08% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.44% | 91.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15286692 |
| LOTUS | LTS0080476 |
| wikiData | Q5638217 |