H-Val-D-gGlu-D-Arg-Gly-OH
Internal ID | 77e47061-ac95-43c4-97d9-7c56193d2253 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
IUPAC Name | (2R)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-[[(2R)-1-(carboxymethylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
SMILES (Canonical) | CC(C)C(C(=O)NC(CCC(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)O)C(=O)O)N |
SMILES (Isomeric) | CC(C)[C@@H](C(=O)N[C@H](CCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)O)C(=O)O)N |
InChI | InChI=1S/C18H33N7O7/c1-9(2)14(19)16(30)25-11(17(31)32)5-6-12(26)24-10(4-3-7-22-18(20)21)15(29)23-8-13(27)28/h9-11,14H,3-8,19H2,1-2H3,(H,23,29)(H,24,26)(H,25,30)(H,27,28)(H,31,32)(H4,20,21,22)/t10-,11-,14+/m1/s1 |
InChI Key | LTKLLKUVWGIOLS-GYSYKLTISA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H33N7O7 |
Molecular Weight | 459.50 g/mol |
Exact Mass | 459.24414642 g/mol |
Topological Polar Surface Area (TPSA) | 252.00 Ų |
XlogP | -4.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.90% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 99.08% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.04% | 99.17% |
CHEMBL236 | P41143 | Delta opioid receptor | 96.40% | 99.35% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.49% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.09% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.89% | 90.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.33% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.80% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.73% | 93.56% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 91.56% | 90.20% |
CHEMBL4608 | P33032 | Melanocortin receptor 5 | 91.31% | 97.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.17% | 90.71% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.85% | 96.47% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.30% | 94.45% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 90.15% | 96.67% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.40% | 97.23% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 88.99% | 96.28% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.82% | 100.00% |
CHEMBL3776 | Q14790 | Caspase-8 | 86.67% | 97.06% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.43% | 89.50% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 85.82% | 97.88% |
CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 85.13% | 93.33% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.75% | 98.05% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.71% | 98.33% |
CHEMBL3308 | P55212 | Caspase-6 | 84.27% | 97.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.18% | 93.00% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.87% | 96.67% |
CHEMBL4644 | P41968 | Melanocortin receptor 3 | 83.74% | 99.52% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 81.95% | 87.45% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.39% | 95.38% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.25% | 96.00% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.24% | 89.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.05% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.03% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax ginseng |
PubChem | 15838983 |
LOTUS | LTS0074561 |
wikiData | Q105156985 |