H-Tyr-Gln-Val-Pro-OH
| Internal ID | 3515bc9a-3bba-4171-a728-bc6e52a38570 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-5-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CC(C)C(C(=O)N1CCCC1C(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C(CC2=CC=C(C=C2)O)N |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CC2=CC=C(C=C2)O)N |
| InChI | InChI=1S/C24H35N5O7/c1-13(2)20(23(34)29-11-3-4-18(29)24(35)36)28-22(33)17(9-10-19(26)31)27-21(32)16(25)12-14-5-7-15(30)8-6-14/h5-8,13,16-18,20,30H,3-4,9-12,25H2,1-2H3,(H2,26,31)(H,27,32)(H,28,33)(H,35,36)/t16-,17-,18-,20-/m0/s1 |
| InChI Key | OXDRUVUDFAXCKB-JPLJXNOCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H35N5O7 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.25364847 g/mol |
| Topological Polar Surface Area (TPSA) | 205.00 Ų |
| XlogP | -4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.66% | 98.95% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.45% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.11% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.21% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.49% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.12% | 93.10% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.96% | 96.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.70% | 93.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.61% | 93.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.46% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.19% | 95.89% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 91.49% | 99.17% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.44% | 98.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 90.11% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.60% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.92% | 90.71% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.82% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.46% | 97.93% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.09% | 99.17% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.37% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.07% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.30% | 82.69% |
| CHEMBL1808 | P12821 | Angiotensin-converting enzyme | 86.26% | 93.39% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.23% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 85.88% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.61% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.60% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.59% | 95.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.50% | 97.23% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 85.10% | 96.67% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.13% | 85.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.39% | 97.64% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 83.14% | 96.67% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.49% | 97.25% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.13% | 97.21% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.32% | 83.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.78% | 83.82% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.16% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684322 |
| LOTUS | LTS0211008 |
| wikiData | Q105202539 |