H-Pyr-Gln-Asp-Tyr(SO3H)-Thr-Gly-Ser-His-Met-Asp-Phe-NH2
| Internal ID | db6803ae-f535-490f-886c-240108131705 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (3S)-3-[[(2S)-5-amino-5-oxo-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-[[(2S)-1-[[(2S,3R)-1-[[2-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-carboxy-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxo-3-(4-sulfooxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CC(C(C(=O)NCC(=O)NC(CO)C(=O)NC(CC1=CN=CN1)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(CC2=CC=CC=C2)C(=O)N)NC(=O)C(CC3=CC=C(C=C3)OS(=O)(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C4CCC(=O)N4)O |
| SMILES (Isomeric) | C[C@H]([C@@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CN=CN1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)N)NC(=O)[C@H](CC3=CC=C(C=C3)OS(=O)(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H]4CCC(=O)N4)O |
| InChI | InChI=1S/C56H75N15O23S2/c1-27(73)46(71-54(88)36(19-29-8-10-31(11-9-29)94-96(91,92)93)67-53(87)39(22-45(79)80)69-49(83)33(12-14-41(57)74)64-48(82)32-13-15-42(75)62-32)56(90)60-24-43(76)63-40(25-72)55(89)68-37(20-30-23-59-26-61-30)51(85)65-34(16-17-95-2)50(84)70-38(21-44(77)78)52(86)66-35(47(58)81)18-28-6-4-3-5-7-28/h3-11,23,26-27,32-40,46,72-73H,12-22,24-25H2,1-2H3,(H2,57,74)(H2,58,81)(H,59,61)(H,60,90)(H,62,75)(H,63,76)(H,64,82)(H,65,85)(H,66,86)(H,67,87)(H,68,89)(H,69,83)(H,70,84)(H,71,88)(H,77,78)(H,79,80)(H,91,92,93)/t27-,32+,33+,34+,35+,36+,37+,38+,39+,40+,46+/m1/s1 |
| InChI Key | ZDCLUECBLKCGMB-KCJCLTGYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H75N15O23S2 |
| Molecular Weight | 1390.40 g/mol |
| Exact Mass | 1389.46016605 g/mol |
| Topological Polar Surface Area (TPSA) | 647.00 Ų |
| XlogP | -6.30 |
| Atomic LogP (AlogP) | -7.80 |
| H-Bond Acceptor | 22 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 41 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7899 | 78.99% |
| Caco-2 | - | 0.8651 | 86.51% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Lysosomes | 0.3824 | 38.24% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7979 | 79.79% |
| OATP1B3 inhibitior | + | 0.9317 | 93.17% |
| MATE1 inhibitior | - | 0.8428 | 84.28% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | + | 0.9487 | 94.87% |
| P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
| P-glycoprotein substrate | + | 0.8418 | 84.18% |
| CYP3A4 substrate | + | 0.7386 | 73.86% |
| CYP2C9 substrate | - | 0.8043 | 80.43% |
| CYP2D6 substrate | - | 0.8670 | 86.70% |
| CYP3A4 inhibition | - | 0.8700 | 87.00% |
| CYP2C9 inhibition | - | 0.7508 | 75.08% |
| CYP2C19 inhibition | - | 0.7477 | 74.77% |
| CYP2D6 inhibition | - | 0.8536 | 85.36% |
| CYP1A2 inhibition | - | 0.7909 | 79.09% |
| CYP2C8 inhibition | + | 0.8000 | 80.00% |
| CYP inhibitory promiscuity | - | 0.9002 | 90.02% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | + | 0.5400 | 54.00% |
| Carcinogenicity (trinary) | Non-required | 0.6017 | 60.17% |
| Eye corrosion | - | 0.9789 | 97.89% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7666 | 76.66% |
| Skin corrosion | - | 0.9145 | 91.45% |
| Ames mutagenesis | - | 0.7800 | 78.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7080 | 70.80% |
| Micronuclear | + | 0.8700 | 87.00% |
| Hepatotoxicity | - | 0.6164 | 61.64% |
| skin sensitisation | - | 0.8386 | 83.86% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | + | 0.8667 | 86.67% |
| Mitochondrial toxicity | + | 0.7250 | 72.50% |
| Nephrotoxicity | - | 0.8487 | 84.87% |
| Acute Oral Toxicity (c) | III | 0.5711 | 57.11% |
| Estrogen receptor binding | + | 0.5836 | 58.36% |
| Androgen receptor binding | + | 0.7095 | 70.95% |
| Thyroid receptor binding | + | 0.7276 | 72.76% |
| Glucocorticoid receptor binding | + | 0.7621 | 76.21% |
| Aromatase binding | + | 0.7596 | 75.96% |
| PPAR gamma | + | 0.6988 | 69.88% |
| Honey bee toxicity | - | 0.6724 | 67.24% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.6800 | 68.00% |
| Fish aquatic toxicity | + | 0.7346 | 73.46% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.95% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.87% | 83.82% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.11% | 97.64% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.21% | 90.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.11% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.90% | 96.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.80% | 97.23% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.78% | 95.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.43% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.27% | 97.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.18% | 88.42% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.74% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.55% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.70% | 93.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 94.24% | 94.66% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.99% | 98.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.82% | 96.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.52% | 90.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.93% | 97.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.72% | 98.75% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 92.47% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.81% | 82.69% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 90.89% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.23% | 98.59% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.21% | 98.94% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.09% | 91.81% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 89.85% | 94.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.37% | 96.67% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 89.21% | 95.52% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.05% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.27% | 93.03% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.04% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.73% | 99.23% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.57% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.53% | 99.15% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.52% | 89.63% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 85.30% | 82.50% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.84% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.51% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.26% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.03% | 96.25% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.66% | 88.56% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 81.87% | 82.86% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.83% | 85.31% |
| CHEMBL5028 | O14672 | ADAM10 | 81.54% | 97.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.28% | 94.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.19% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101008413 |
| LOTUS | LTS0070043 |
| wikiData | Q105372070 |