H-Glu-Ile-Glu-Lys-Arg-Ala-Glu-Glu-Leu-Ser-Gly-Gln-Ile-Asp-Ser-OH
| Internal ID | e30ae2d3-df6b-4077-bf95-da145c23bbd4 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (4S)-4-amino-5-[[(2S,3S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[2-[[(2S)-5-amino-1-[[(2S,3S)-1-[[(2S)-3-carboxy-1-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-oxoethyl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-carboxy-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NCC(=O)NC(CCC(=O)N)C(=O)NC(C(C)CC)C(=O)NC(CC(=O)O)C(=O)NC(CO)C(=O)O)NC(=O)C(CCC(=O)O)N |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](CCC(=O)O)N |
| InChI | InChI=1S/C70H118N20O29/c1-8-33(5)54(89-57(106)36(72)15-21-49(95)96)67(116)84-42(19-24-52(101)102)62(111)81-37(13-10-11-25-71)60(109)82-38(14-12-26-76-70(74)75)59(108)78-35(7)56(105)80-40(17-22-50(97)98)61(110)83-41(18-23-51(99)100)63(112)85-43(27-32(3)4)65(114)87-45(30-91)58(107)77-29-48(94)79-39(16-20-47(73)93)64(113)90-55(34(6)9-2)68(117)86-44(28-53(103)104)66(115)88-46(31-92)69(118)119/h32-46,54-55,91-92H,8-31,71-72H2,1-7H3,(H2,73,93)(H,77,107)(H,78,108)(H,79,94)(H,80,105)(H,81,111)(H,82,109)(H,83,110)(H,84,116)(H,85,112)(H,86,117)(H,87,114)(H,88,115)(H,89,106)(H,90,113)(H,95,96)(H,97,98)(H,99,100)(H,101,102)(H,103,104)(H,118,119)(H4,74,75,76)/t33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,54-,55-/m0/s1 |
| InChI Key | KBRYSIRAJIVHAO-KFVCWCRGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C70H118N20O29 |
| Molecular Weight | 1703.80 g/mol |
| Exact Mass | 1702.8373578 g/mol |
| Topological Polar Surface Area (TPSA) | 831.00 Ų |
| XlogP | -12.90 |
| Atomic LogP (AlogP) | -9.66 |
| H-Bond Acceptor | 26 |
| H-Bond Donor | 27 |
| Rotatable Bonds | 62 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7214 | 72.14% |
| Caco-2 | - | 0.8584 | 85.84% |
| Blood Brain Barrier | - | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.6325 | 63.25% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8561 | 85.61% |
| OATP1B3 inhibitior | + | 0.9365 | 93.65% |
| MATE1 inhibitior | - | 0.8400 | 84.00% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.8956 | 89.56% |
| P-glycoprotein inhibitior | + | 0.7416 | 74.16% |
| P-glycoprotein substrate | + | 0.8192 | 81.92% |
| CYP3A4 substrate | + | 0.6954 | 69.54% |
| CYP2C9 substrate | + | 0.5951 | 59.51% |
| CYP2D6 substrate | - | 0.8303 | 83.03% |
| CYP3A4 inhibition | - | 0.8500 | 85.00% |
| CYP2C9 inhibition | - | 0.8246 | 82.46% |
| CYP2C19 inhibition | - | 0.7822 | 78.22% |
| CYP2D6 inhibition | - | 0.8529 | 85.29% |
| CYP1A2 inhibition | - | 0.8495 | 84.95% |
| CYP2C8 inhibition | + | 0.6068 | 60.68% |
| CYP inhibitory promiscuity | - | 0.9814 | 98.14% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.5933 | 59.33% |
| Eye corrosion | - | 0.9795 | 97.95% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.8029 | 80.29% |
| Skin corrosion | - | 0.9400 | 94.00% |
| Ames mutagenesis | - | 0.6900 | 69.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6808 | 68.08% |
| Micronuclear | + | 0.5600 | 56.00% |
| Hepatotoxicity | + | 0.5209 | 52.09% |
| skin sensitisation | - | 0.8556 | 85.56% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.5170 | 51.70% |
| Mitochondrial toxicity | - | 0.5125 | 51.25% |
| Nephrotoxicity | + | 0.5304 | 53.04% |
| Acute Oral Toxicity (c) | III | 0.6501 | 65.01% |
| Estrogen receptor binding | + | 0.5322 | 53.22% |
| Androgen receptor binding | + | 0.7064 | 70.64% |
| Thyroid receptor binding | + | 0.7040 | 70.40% |
| Glucocorticoid receptor binding | + | 0.7817 | 78.17% |
| Aromatase binding | + | 0.7910 | 79.10% |
| PPAR gamma | + | 0.7544 | 75.44% |
| Honey bee toxicity | - | 0.7920 | 79.20% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6700 | 67.00% |
| Fish aquatic toxicity | - | 0.5089 | 50.89% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.82% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.82% | 99.35% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.75% | 83.82% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 99.45% | 98.94% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.90% | 97.23% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.88% | 89.63% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.56% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 98.41% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.17% | 93.56% |
| CHEMBL3837 | P07711 | Cathepsin L | 97.72% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.69% | 100.00% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 97.64% | 99.77% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.63% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.57% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 97.19% | 97.21% |
| CHEMBL4801 | P29466 | Caspase-1 | 97.10% | 96.85% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.10% | 96.67% |
| CHEMBL3776 | Q14790 | Caspase-8 | 96.91% | 97.06% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.87% | 98.05% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.35% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.04% | 90.17% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 95.69% | 98.10% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 95.68% | 98.89% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.45% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.50% | 98.33% |
| CHEMBL204 | P00734 | Thrombin | 94.24% | 96.01% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 93.88% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.70% | 96.47% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.46% | 95.17% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 92.64% | 92.32% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 91.74% | 95.20% |
| CHEMBL2334 | P42574 | Caspase-3 | 91.17% | 98.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.06% | 90.71% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.71% | 93.18% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.21% | 96.95% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.93% | 96.90% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 89.85% | 95.52% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.56% | 89.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 89.47% | 96.28% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.41% | 91.19% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.41% | 97.29% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.07% | 93.10% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.95% | 95.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.18% | 93.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.93% | 96.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.85% | 94.66% |
| CHEMBL3308 | P55212 | Caspase-6 | 87.72% | 97.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.58% | 96.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.51% | 100.00% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 87.30% | 97.78% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 87.27% | 96.73% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.57% | 95.71% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 86.45% | 93.33% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.95% | 87.45% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 85.86% | 86.67% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 84.67% | 97.88% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 84.16% | 97.43% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.73% | 96.37% |
| CHEMBL3984 | Q99640 | Tyrosine- and threonine-specific cdc2-inhibitory kinase | 83.40% | 85.00% |
| CHEMBL4079 | P25098 | G-protein coupled receptor kinase 2 | 82.09% | 97.95% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.04% | 94.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.60% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.31% | 94.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.28% | 96.67% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.09% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.76% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.40% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101944856 |
| LOTUS | LTS0214884 |
| wikiData | Q105138499 |