H-DL-Pyr-DL-Gln-DL-Trp-DL-Ala-DL-Val-Gly-DL-His-DL-Phe-DL-Met-NH2
| Internal ID | fd3abb82-7745-4ac8-afcd-5c7b9b2ebe9c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | N-[1-[[1-[[1-[[2-[[1-[[1-[(1-amino-4-methylsulfanyl-1-oxobutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[(5-oxopyrrolidine-2-carbonyl)amino]pentanediamide |
| SMILES (Canonical) | CC(C)C(C(=O)NCC(=O)NC(CC1=CN=CN1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(CCSC)C(=O)N)NC(=O)C(C)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CCC(=O)N)NC(=O)C5CCC(=O)N5 |
| SMILES (Isomeric) | CC(C)C(C(=O)NCC(=O)NC(CC1=CN=CN1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(CCSC)C(=O)N)NC(=O)C(C)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CCC(=O)N)NC(=O)C5CCC(=O)N5 |
| InChI | InChI=1S/C51H68N14O11S/c1-27(2)43(51(76)56-25-42(68)60-39(22-31-24-54-26-57-31)50(75)63-37(20-29-10-6-5-7-11-29)49(74)61-34(44(53)69)18-19-77-4)65-45(70)28(3)58-48(73)38(21-30-23-55-33-13-9-8-12-32(30)33)64-47(72)36(14-16-40(52)66)62-46(71)35-15-17-41(67)59-35/h5-13,23-24,26-28,34-39,43,55H,14-22,25H2,1-4H3,(H2,52,66)(H2,53,69)(H,54,57)(H,56,76)(H,58,73)(H,59,67)(H,60,68)(H,61,74)(H,62,71)(H,63,75)(H,64,72)(H,65,70) |
| InChI Key | OHCNRADJYUSTIV-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C51H68N14O11S |
| Molecular Weight | 1085.20 g/mol |
| Exact Mass | 1084.49127021 g/mol |
| Topological Polar Surface Area (TPSA) | 418.00 Ų |
| XlogP | -0.30 |
| Atomic LogP (AlogP) | -2.11 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 30 |
| CAS_5486808 |
| NSC_5486808 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9674 | 96.74% |
| Caco-2 | - | 0.8717 | 87.17% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Nucleus | 0.4026 | 40.26% |
| OATP2B1 inhibitior | - | 0.8539 | 85.39% |
| OATP1B1 inhibitior | + | 0.8039 | 80.39% |
| OATP1B3 inhibitior | + | 0.9407 | 94.07% |
| MATE1 inhibitior | - | 0.9009 | 90.09% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9814 | 98.14% |
| P-glycoprotein inhibitior | + | 0.7454 | 74.54% |
| P-glycoprotein substrate | + | 0.8769 | 87.69% |
| CYP3A4 substrate | + | 0.7377 | 73.77% |
| CYP2C9 substrate | - | 0.8042 | 80.42% |
| CYP2D6 substrate | - | 0.8639 | 86.39% |
| CYP3A4 inhibition | - | 0.9379 | 93.79% |
| CYP2C9 inhibition | - | 0.6666 | 66.66% |
| CYP2C19 inhibition | - | 0.7505 | 75.05% |
| CYP2D6 inhibition | - | 0.8964 | 89.64% |
| CYP1A2 inhibition | - | 0.8730 | 87.30% |
| CYP2C8 inhibition | + | 0.7611 | 76.11% |
| CYP inhibitory promiscuity | - | 0.9280 | 92.80% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.6636 | 66.36% |
| Eye corrosion | - | 0.9879 | 98.79% |
| Eye irritation | - | 0.8983 | 89.83% |
| Skin irritation | - | 0.7830 | 78.30% |
| Skin corrosion | - | 0.9249 | 92.49% |
| Ames mutagenesis | - | 0.8200 | 82.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7459 | 74.59% |
| Micronuclear | + | 0.5500 | 55.00% |
| Hepatotoxicity | - | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8700 | 87.00% |
| Respiratory toxicity | + | 0.9222 | 92.22% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | - | 0.9106 | 91.06% |
| Acute Oral Toxicity (c) | III | 0.6189 | 61.89% |
| Estrogen receptor binding | + | 0.7396 | 73.96% |
| Androgen receptor binding | + | 0.6157 | 61.57% |
| Thyroid receptor binding | + | 0.6330 | 63.30% |
| Glucocorticoid receptor binding | + | 0.6208 | 62.08% |
| Aromatase binding | + | 0.7132 | 71.32% |
| PPAR gamma | + | 0.7028 | 70.28% |
| Honey bee toxicity | - | 0.6907 | 69.07% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
| Fish aquatic toxicity | - | 0.5498 | 54.98% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.55% | 97.64% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.37% | 97.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 98.68% | 95.38% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.96% | 83.82% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.89% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.79% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.19% | 89.63% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 96.94% | 99.52% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 96.93% | 88.42% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.66% | 90.20% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 96.15% | 88.56% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.78% | 91.81% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.60% | 90.08% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.50% | 98.75% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 95.22% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.22% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.05% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.40% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.51% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.06% | 99.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.88% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.60% | 99.23% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.24% | 98.24% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.10% | 95.56% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 88.63% | 90.65% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.99% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.72% | 93.03% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.39% | 95.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.85% | 82.69% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 86.40% | 95.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.88% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 85.66% | 97.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 84.74% | 96.28% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.21% | 98.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.99% | 93.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.75% | 96.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.70% | 96.67% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.40% | 82.86% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.33% | 92.98% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.23% | 96.76% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 83.12% | 82.50% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.99% | 94.66% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 82.78% | 99.23% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.30% | 96.25% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 82.19% | 95.00% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 82.04% | 97.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.01% | 97.14% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 81.91% | 92.22% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.46% | 96.90% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 81.18% | 98.94% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.69% | 89.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.57% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.24% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.17% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14235547 |
| LOTUS | LTS0119602 |
| wikiData | Q105192002 |