H-DL-Pyr-DL-Ala-DL-Asp-DL-Pro-DL-Asn-DL-Ala-DL-Phe-DL-Tyr-Gly-DL-Leu-DL-Met-NH2
| Internal ID | 9f06b43f-7635-458c-b1eb-262c9bf11e14 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 4-[2-[[4-amino-1-[[1-[[1-[[1-[[2-[[1-[(1-amino-4-methylsulfanyl-1-oxobutan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-oxo-3-[2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoylamino]butanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)CNC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(C)NC(=O)C(CC(=O)N)NC(=O)C3CCCN3C(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C4CCC(=O)N4 |
| SMILES (Isomeric) | CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)CNC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(C)NC(=O)C(CC(=O)N)NC(=O)C3CCCN3C(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C4CCC(=O)N4 |
| InChI | InChI=1S/C55H77N13O16S/c1-28(2)22-36(52(81)63-34(46(57)75)19-21-85-5)62-44(72)27-58-49(78)37(24-32-13-15-33(69)16-14-32)65-53(82)38(23-31-10-7-6-8-11-31)64-47(76)29(3)60-51(80)39(25-42(56)70)66-54(83)41-12-9-20-68(41)55(84)40(26-45(73)74)67-48(77)30(4)59-50(79)35-17-18-43(71)61-35/h6-8,10-11,13-16,28-30,34-41,69H,9,12,17-27H2,1-5H3,(H2,56,70)(H2,57,75)(H,58,78)(H,59,79)(H,60,80)(H,61,71)(H,62,72)(H,63,81)(H,64,76)(H,65,82)(H,66,83)(H,67,77)(H,73,74) |
| InChI Key | HRAACOKBZHCXOF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H77N13O16S |
| Molecular Weight | 1208.30 g/mol |
| Exact Mass | 1207.53319459 g/mol |
| Topological Polar Surface Area (TPSA) | 480.00 Ų |
| XlogP | -1.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.99% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.89% | 89.63% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.38% | 97.64% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.60% | 99.35% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 98.47% | 90.20% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.26% | 97.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.93% | 96.09% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.85% | 96.67% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 97.50% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.49% | 98.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.74% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.45% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.32% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.18% | 98.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.15% | 93.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.05% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.91% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.47% | 95.38% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 95.30% | 95.52% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.04% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.98% | 82.69% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.31% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.22% | 93.56% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.12% | 91.81% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 93.64% | 100.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 93.62% | 96.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.19% | 94.45% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 93.00% | 98.10% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 92.87% | 96.03% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.66% | 90.08% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.99% | 83.82% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.89% | 91.19% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.60% | 99.17% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 90.30% | 98.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.69% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.61% | 93.10% |
| CHEMBL4801 | P29466 | Caspase-1 | 89.43% | 96.85% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 89.11% | 96.67% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.82% | 82.38% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.54% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.73% | 96.47% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 87.58% | 99.17% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.91% | 94.66% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.01% | 90.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.01% | 95.89% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 85.32% | 85.00% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 85.16% | 99.52% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 85.07% | 82.50% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 84.95% | 92.80% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 84.72% | 93.33% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 83.34% | 88.42% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.59% | 88.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.16% | 99.15% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 82.14% | 98.94% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.39% | 100.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.19% | 83.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.08% | 96.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.75% | 95.00% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 80.50% | 92.50% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 80.25% | 99.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85118837 |
| LOTUS | LTS0224053 |
| wikiData | Q105032534 |