H-bAla(2-OH,3-pentyl)-DL-Val-DL-N(Me)xiIle-DL-N(Me)Tyr-OH
| Internal ID | ab2a4a2d-18ee-479b-9032-31690ca4d49f |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-[[2-[[2-[(3-amino-2-hydroxyoctanoyl)amino]-3-methylbutanoyl]-methylamino]-3-methylpentanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCCCCC(C(C(=O)NC(C(C)C)C(=O)N(C)C(C(C)CC)C(=O)N(C)C(CC1=CC=C(C=C1)O)C(=O)O)O)N |
| SMILES (Isomeric) | CCCCCC(C(C(=O)NC(C(C)C)C(=O)N(C)C(C(C)CC)C(=O)N(C)C(CC1=CC=C(C=C1)O)C(=O)O)O)N |
| InChI | InChI=1S/C30H50N4O7/c1-8-10-11-12-22(31)26(36)27(37)32-24(18(3)4)28(38)34(7)25(19(5)9-2)29(39)33(6)23(30(40)41)17-20-13-15-21(35)16-14-20/h13-16,18-19,22-26,35-36H,8-12,17,31H2,1-7H3,(H,32,37)(H,40,41) |
| InChI Key | UDNHSOSLMVFALQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H50N4O7 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.36794995 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.97% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.89% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.61% | 93.56% |
| CHEMBL4072 | P07858 | Cathepsin B | 94.06% | 93.67% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.95% | 97.29% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.66% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.65% | 90.20% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.36% | 90.71% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.58% | 83.82% |
| CHEMBL268 | P43235 | Cathepsin K | 88.48% | 96.85% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 88.28% | 96.37% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.23% | 95.56% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.27% | 96.61% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.26% | 92.86% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.11% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.52% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.72% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.04% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.35% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.91% | 95.50% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.97% | 93.04% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.19% | 90.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.63% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73837483 |
| LOTUS | LTS0066281 |
| wikiData | Q104198096 |