H-bAla(2-OH,3-heptyl)-DL-xiThr-DL-Pro-DL-Tyr-DL-Tyr-OH
| Internal ID | f474e0a0-1f9c-4307-9363-bcf3402c54e9 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-[[2-[[1-[2-[(3-amino-2-hydroxydecanoyl)amino]-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CCCCCCCC(C(C(=O)NC(C(C)O)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)O)N |
| SMILES (Isomeric) | CCCCCCCC(C(C(=O)NC(C(C)O)C(=O)N1CCCC1C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)O)O)N |
| InChI | InChI=1S/C37H53N5O10/c1-3-4-5-6-7-9-27(38)32(46)35(49)41-31(22(2)43)36(50)42-19-8-10-30(42)34(48)39-28(20-23-11-15-25(44)16-12-23)33(47)40-29(37(51)52)21-24-13-17-26(45)18-14-24/h11-18,22,27-32,43-46H,3-10,19-21,38H2,1-2H3,(H,39,48)(H,40,47)(H,41,49)(H,51,52) |
| InChI Key | MQLHZIBESRENLM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H53N5O10 |
| Molecular Weight | 727.80 g/mol |
| Exact Mass | 727.37924290 g/mol |
| Topological Polar Surface Area (TPSA) | 252.00 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.89% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.00% | 89.63% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 98.70% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.66% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.60% | 93.56% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 97.58% | 96.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.22% | 93.10% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.03% | 98.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.68% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.02% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.58% | 91.81% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.43% | 94.45% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.74% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.25% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.24% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.64% | 95.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 92.32% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.23% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.00% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.58% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.70% | 91.19% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.17% | 97.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.09% | 90.17% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 90.04% | 95.52% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.98% | 96.67% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.81% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.34% | 95.56% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 88.84% | 97.79% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.82% | 92.86% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.18% | 93.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 87.47% | 98.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.45% | 95.89% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.32% | 95.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.89% | 97.14% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.58% | 97.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.47% | 91.11% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.09% | 99.35% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 83.19% | 99.17% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.96% | 82.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.86% | 90.08% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.83% | 97.50% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.80% | 91.76% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.02% | 92.86% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.26% | 98.10% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.70% | 94.33% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.21% | 95.38% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.09% | 97.21% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 80.03% | 92.22% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163149002 |
| LOTUS | LTS0084156 |
| wikiData | Q104887528 |