Gyrocarpusine
Internal ID | 27ad2b1e-97ca-46e7-a42d-ba4a47a4a43d |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | (1R,14R)-6,21,25-trimethoxy-15,30-dimethyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-20-ol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6C)OC)O3)OC)OC)O |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@@H]6C7=CC(=C(C=C7CCN6C)OC)O3)OC)OC)O |
InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-20-32(42-4)34-21-27(24)28(38)17-23-8-11-31(41-3)33(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)19-30(40)36(43-5)37(35)45-34/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m1/s1 |
InChI Key | VXPVPAHQYCJDTP-FQLXRVMXSA-N |
Popularity | 6 references in papers |
Molecular Formula | C37H40N2O6 |
Molecular Weight | 608.70 g/mol |
Exact Mass | 608.28863700 g/mol |
Topological Polar Surface Area (TPSA) | 72.90 Ų |
XlogP | 6.30 |
102518-66-1 |
Gyrocarpin |
DTXSID80907684 |
6',7,12'-Trimethoxy-2,2'-dimethyloxyacanthan-6-ol |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.54% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.54% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.39% | 91.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.52% | 93.40% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.27% | 91.11% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.22% | 89.62% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.66% | 93.99% |
CHEMBL2581 | P07339 | Cathepsin D | 89.14% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.91% | 94.45% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.88% | 82.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.39% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 87.38% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.63% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.30% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.69% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.84% | 90.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.71% | 95.78% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.35% | 94.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.81% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.90% | 95.89% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 81.72% | 96.76% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.67% | 92.94% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.45% | 86.33% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.30% | 89.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.30% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.13% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gyrocarpus americanus |
PubChem | 190388 |
LOTUS | LTS0026641 |
wikiData | Q82876842 |