Gypsophilin
Internal ID | 5ac8daac-abce-4604-a504-2c9558b28506 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9S,11aR,11bR,13aR,13bR)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-sulfooxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a,8-dicarboxylic acid |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C(=O)O)OS(=O)(=O)O)C)C(=O)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H]([C@@]([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C(=O)O)OS(=O)(=O)O)C)C(=O)O |
InChI | InChI=1S/C30H46O8S/c1-17(2)18-9-14-30(25(33)34)16-15-27(4)19(23(18)30)7-8-20-26(3)12-11-22(38-39(35,36)37)29(6,24(31)32)21(26)10-13-28(20,27)5/h18-23H,1,7-16H2,2-6H3,(H,31,32)(H,33,34)(H,35,36,37)/t18-,19+,20+,21+,22-,23+,26+,27+,28+,29-,30-/m0/s1 |
InChI Key | YJZUFDBGHBUWHO-NIJGOTLYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H46O8S |
Molecular Weight | 566.70 g/mol |
Exact Mass | 566.29133959 g/mol |
Topological Polar Surface Area (TPSA) | 147.00 Ų |
XlogP | 6.50 |
(1R,3aS,5aR,5bR,7aR,8S,9S,11aR,11bR,13aR,13bR)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-9-sulfooxy-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a,8-dicarboxylic acid |
![2D Structure of Gypsophilin 2D Structure of Gypsophilin](https://plantaedb.com/storage/docs/compounds/2023/11/gypsophilin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.55% | 96.38% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.49% | 91.19% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.13% | 83.82% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 93.07% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.77% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.22% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.31% | 94.45% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 88.22% | 92.97% |
CHEMBL2581 | P07339 | Cathepsin D | 87.44% | 98.95% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.37% | 93.03% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.37% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.43% | 97.25% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.99% | 97.93% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.96% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.70% | 100.00% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.65% | 99.17% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.37% | 94.66% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.79% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.69% | 95.50% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.50% | 82.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.31% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gypsophila elegans |
Gypsophila repens |
PubChem | 16724595 |
LOTUS | LTS0205146 |
wikiData | Q105349568 |