Gymnopeptide A
| Internal ID | f0c67bda-7fc6-451c-80a1-b5431b7bb217 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (3S,9S,12S,15S,18S,21S,24S,27S,30S,33S,36S,39S,42S,45S,51S,54S)-33-(hydroxymethyl)-1,4,7,13,15,19,25,31,37,39,43,45,49,54-tetradecamethyl-3,9,12,18,21,24,27,30,36,42,51-undeca(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52-octadecazacyclotetrapentacontane-2,5,8,11,14,17,20,23,26,29,32,35,38,41,44,47,50,53-octadecone |
| SMILES (Canonical) | CC1C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)N(C(C(=O)NC(C(=O)N(CC(=O)N1)C)C(C)C)C)C)C(C)C)C)C)C(C)C)C(C)C)C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)CO)C(C)C)C)C)C(C)C)C |
| SMILES (Isomeric) | C[C@H]1C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N(CC(=O)N([C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N(CC(=O)N1)C)C(C)C)C)C)C(C)C)C)C)C(C)C)C(C)C)C)C)C(C)C)C)C(C)C)C(C)C)C)C(C)C)C(C)C)C)CO)C(C)C)C)C)C(C)C)C |
| InChI | InChI=1S/C84H150N18O19/c1-40(2)58-80(117)93(27)37-56(104)85-51(23)76(113)97(31)62(44(9)10)70(107)86-52(24)77(114)98(32)64(46(13)14)72(109)88-55(39-103)79(116)100(34)66(48(17)18)74(111)91-61(43(7)8)83(120)102(36)67(49(19)20)75(112)92-60(42(5)6)82(119)101(35)63(45(11)12)71(108)87-53(25)78(115)99(33)65(47(15)16)73(110)90-59(41(3)4)81(118)94(28)38-57(105)96(30)68(50(21)22)84(121)95(29)54(26)69(106)89-58/h40-55,58-68,103H,37-39H2,1-36H3,(H,85,104)(H,86,107)(H,87,108)(H,88,109)(H,89,106)(H,90,110)(H,91,111)(H,92,112)/t51-,52-,53-,54-,55-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-/m0/s1 |
| InChI Key | UKMCVIMJRQDJCZ-XBELMMIXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C84H150N18O19 |
| Molecular Weight | 1716.20 g/mol |
| Exact Mass | 1715.13246463 g/mol |
| Topological Polar Surface Area (TPSA) | 456.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.76% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.26% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL1949 | P62937 | Cyclophilin A | 96.41% | 98.57% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.42% | 90.08% |
| CHEMBL4072 | P07858 | Cathepsin B | 93.38% | 93.67% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.92% | 88.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.52% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.53% | 94.66% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.35% | 98.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.46% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.70% | 94.75% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.20% | 97.79% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.85% | 98.59% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 84.40% | 92.12% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 84.39% | 96.31% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.86% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.25% | 93.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.99% | 94.45% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.09% | 97.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132562359 |
| LOTUS | LTS0197812 |
| wikiData | Q77570082 |