Gymnemic acid VIII
Internal ID | 8bca994a-48d0-486e-8372-646c6c668b1a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4R,4aR,6aR,6bS,8S,8aR,9R,10R,12aS,14aR,14bR)-8,9-dihydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(2S)-2-methylbutanoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(2S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxy-3,5-dihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)OC7C(=O)C(C(C(O7)CO)O)O)O)C)CO)O |
SMILES (Isomeric) | CC[C@H](C)C(=O)O[C@H]1[C@@H]([C@@]2([C@H](C[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@@]5(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O[C@H]7C(=O)[C@H]([C@@H]([C@H](O7)CO)O)O)O)C)C)[C@@H]2CC1(C)C)C)O)CO)O |
InChI | InChI=1S/C47H74O18/c1-9-21(2)39(60)65-37-36(57)47(20-50)23(16-42(37,3)4)22-10-11-26-43(5)14-13-28(44(6,19-49)25(43)12-15-45(26,7)46(22,8)17-27(47)51)62-41-33(56)34(32(55)35(64-41)38(58)59)63-40-31(54)30(53)29(52)24(18-48)61-40/h10,21,23-30,32-37,40-41,48-53,55-57H,9,11-20H2,1-8H3,(H,58,59)/t21-,23-,24+,25+,26+,27-,28-,29+,30-,32-,33+,34-,35-,36-,37-,40-,41+,43-,44-,45+,46+,47-/m0/s1 |
InChI Key | KIFOYKWBRFBOHQ-XMNCZCGISA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H74O18 |
Molecular Weight | 927.10 g/mol |
Exact Mass | 926.48751551 g/mol |
Topological Polar Surface Area (TPSA) | 300.00 Ų |
XlogP | 2.90 |
(+)-Gymnemic acid VIII |
Gymnemic acid viii, (+)- |
UNII-O9N5N83DZZ |
O9N5N83DZZ |
131653-19-5 |
beta-D-Glucopyranosiduronic acid, (3beta,4alpha,16beta,21beta-(S),22alpha)-16,22,23,28-tetrahydroxy-21-(2-methyl-1-oxobutoxy)olean-12-en-3-yl 3-o-beta-D-arabino-hexopyranos-2-ulos-1-yl- |
Q27285522 |
GYMNEMIC ACID VIII (CONSTITUENT OF GYMNEMA) [DSC] |
.BETA.-D-GLUCOPYRANOSIDURONIC ACID, (3.BETA.,4.ALPHA.,16.BETA.,21.BETA.-(S),22.ALPHA.)-16,22,23,28-TETRAHYDROXY-21-(2-METHYL-1-OXOBUTOXY)OLEAN-12-EN-3-YL 3-O-.BETA.-D-ARABINO-HEXOPYRANOS-2-ULOS-1-YL- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.15% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.19% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.06% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.65% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.62% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.01% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.93% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.86% | 97.09% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.67% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.40% | 95.56% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.60% | 96.21% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.47% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.33% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.16% | 89.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.57% | 95.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.36% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.06% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.65% | 92.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.27% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.77% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.73% | 95.93% |
CHEMBL5028 | O14672 | ADAM10 | 81.70% | 97.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.49% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnema sylvestre |
PubChem | 91617623 |
LOTUS | LTS0195770 |
wikiData | Q27285522 |