Gymnemic acid III
Internal ID | fdca41d2-12b8-41ae-b18a-23836a708b2a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4R,4aR,6aR,6bS,8S,8aR,9R,10R,12aS,14aR,14bR)-8,9-dihydroxy-4,8a-bis(hydroxymethyl)-4,6a,6b,11,11,14b-hexamethyl-10-[(2S)-2-methylbutanoyl]oxy-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2(C(CC1(C)C)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)CO)OC6C(C(C(C(O6)C(=O)O)O)O)O)C)CO)O |
SMILES (Isomeric) | CC[C@H](C)C(=O)O[C@H]1[C@@H]([C@@]2([C@H](C[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H]([C@@]5(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O)C)C)[C@@H]2CC1(C)C)C)O)CO)O |
InChI | InChI=1S/C41H66O13/c1-9-20(2)34(51)54-32-31(48)41(19-43)22(16-36(32,3)4)21-10-11-24-37(5)14-13-26(52-35-29(47)27(45)28(46)30(53-35)33(49)50)38(6,18-42)23(37)12-15-39(24,7)40(21,8)17-25(41)44/h10,20,22-32,35,42-48H,9,11-19H2,1-8H3,(H,49,50)/t20-,22-,23+,24+,25-,26-,27-,28-,29+,30-,31-,32-,35+,37-,38-,39+,40+,41-/m0/s1 |
InChI Key | VLXWTKUXVXJELF-DDRSIQBQSA-N |
Popularity | 10 references in papers |
Molecular Formula | C41H66O13 |
Molecular Weight | 767.00 g/mol |
Exact Mass | 766.45034216 g/mol |
Topological Polar Surface Area (TPSA) | 224.00 Ų |
XlogP | 4.00 |
UNII-I63P1QEJ6A |
I63P1QEJ6A |
122074-65-1 |
beta-D-Glucopyranosiduronic acid, (3beta,4alpha,16beta,21beta,22alpha)-16,22,23,28-tetrahydroxy-21-((2S)-2-methyl-1-oxobutoxy)olean-12-en-3-yl |
Q27280494 |
GYMNEMIC ACID III (CONSTITUENT OF GYMNEMA) [DSC] |
.BETA.-D-GLUCOPYRANOSIDURONIC ACID, (3.BETA.,4.ALPHA.,16.BETA.,21.BETA.,22.ALPHA.)-16,22,23,28-TETRAHYDROXY-21-((2S)-2-METHYL-1-OXOBUTOXY)OLEAN-12-EN-3-YL |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.01% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.22% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.42% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.18% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.74% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.73% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.20% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 88.78% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.00% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.81% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.38% | 86.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.57% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.73% | 97.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.16% | 91.07% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.98% | 96.77% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.65% | 95.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.46% | 95.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.42% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.41% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.32% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.24% | 97.36% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.89% | 97.47% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.59% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnema sylvestre |
PubChem | 14264066 |
LOTUS | LTS0219091 |
wikiData | Q27280494 |