Guttiferone L
Internal ID | e3e20c99-188e-4e9d-b85a-8b7d31f77b7c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
IUPAC Name | (1R,5S,6S,7R)-3-[hydroxy-(2,4,5-trihydroxyphenyl)methylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
SMILES (Canonical) | CC(=CCCC1(C(CC2(C(=O)C(=C(C3=CC(=C(C=C3O)O)O)O)C(=O)C1(C2=O)CC=C(C)C)CC=C(C)C)CC=C(C)C)C)C |
SMILES (Isomeric) | CC(=CCC[C@]1([C@@H](C[C@]2(C(=O)C(=C(C3=CC(=C(C=C3O)O)O)O)C(=O)[C@@]1(C2=O)CC=C(C)C)CC=C(C)C)CC=C(C)C)C)C |
InChI | InChI=1S/C38H50O7/c1-22(2)11-10-16-36(9)26(13-12-23(3)4)21-37(17-14-24(5)6)33(43)31(32(42)27-19-29(40)30(41)20-28(27)39)34(44)38(36,35(37)45)18-15-25(7)8/h11-12,14-15,19-20,26,39-42H,10,13,16-18,21H2,1-9H3/t26-,36+,37+,38-/m1/s1 |
InChI Key | BSBNNDHXXJAOES-HYOCDBLYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C38H50O7 |
Molecular Weight | 618.80 g/mol |
Exact Mass | 618.35565393 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | 10.00 |
(-)-Guttiferone L |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.47% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.50% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.69% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.12% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.05% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.38% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.73% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.71% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.36% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.73% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.62% | 85.14% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.38% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.46% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.28% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.43% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.09% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcinia calcicola |
PubChem | 102080758 |
LOTUS | LTS0094255 |
wikiData | Q104945155 |