Gunnilactam C
| Internal ID | 7f7e628b-54be-432d-997c-a9078f7bc12a |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Aminopyridines and derivatives |
| IUPAC Name | (3S,6S,9E,11S,14S)-3-(4-amino-6-methyl-2-oxo-1H-pyridin-3-yl)-11-hydroxy-6,14-dimethyl-1,7-diazacyclotetradec-9-ene-2,5,8-trione |
| SMILES (Canonical) | CC1CCC(C=CC(=O)NC(C(=O)CC(C(=O)N1)C2=C(C=C(NC2=O)C)N)C)O |
| SMILES (Isomeric) | C[C@H]1CC[C@@H](/C=C/C(=O)N[C@H](C(=O)C[C@H](C(=O)N1)C2=C(C=C(NC2=O)C)N)C)O |
| InChI | InChI=1S/C20H28N4O5/c1-10-4-5-13(25)6-7-17(27)24-12(3)16(26)9-14(19(28)22-10)18-15(21)8-11(2)23-20(18)29/h6-8,10,12-14,25H,4-5,9H2,1-3H3,(H,22,28)(H,24,27)(H3,21,23,29)/b7-6+/t10-,12-,13-,14-/m0/s1 |
| InChI Key | XZOYKSWUMHBJPJ-WGFHNXPCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.20597001 g/mol |
| Topological Polar Surface Area (TPSA) | 151.00 Ų |
| XlogP | -1.00 |
| (3S,6S,9E,11S,14S)-3-(4-amino-6-methyl-2-oxo-1H-pyridin-3-yl)-11-hydroxy-6,14-dimethyl-1,7-diazacyclotetradec-9-ene-2,5,8-trione |
| RefChem:144790 |
| CHEBI:207884 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.41% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.15% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.10% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.11% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.30% | 95.89% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 88.27% | 86.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.41% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.40% | 97.25% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.97% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.59% | 94.45% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.92% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.97% | 100.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.55% | 95.62% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.13% | 93.04% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.08% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.59% | 99.23% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.78% | 92.68% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.18% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132488008 |
| LOTUS | LTS0073925 |
| wikiData | Q105345082 |