Guineamide F
| Internal ID | fd363c93-2f91-4032-865e-8726d0015359 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (3S,6S,16S,19S)-3,16-dibenzyl-4,9,9,17-tetramethyl-6-propan-2-yl-10-propyl-11-oxa-1,4,7,14,17-pentazabicyclo[17.3.0]docosane-2,5,8,12,15,18-hexone |
| SMILES (Canonical) | CCCC1C(C(=O)NC(C(=O)N(C(C(=O)N2CCCC2C(=O)N(C(C(=O)NCC(=O)O1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C)C(C)C)(C)C |
| SMILES (Isomeric) | CCCC1C(C(=O)N[C@H](C(=O)N([C@H](C(=O)N2CCC[C@H]2C(=O)N([C@H](C(=O)NCC(=O)O1)CC3=CC=CC=C3)C)CC4=CC=CC=C4)C)C(C)C)(C)C |
| InChI | InChI=1S/C40H55N5O7/c1-8-16-32-40(4,5)39(51)42-34(26(2)3)38(50)44(7)31(24-28-19-13-10-14-20-28)37(49)45-22-15-21-29(45)36(48)43(6)30(23-27-17-11-9-12-18-27)35(47)41-25-33(46)52-32/h9-14,17-20,26,29-32,34H,8,15-16,21-25H2,1-7H3,(H,41,47)(H,42,51)/t29-,30-,31-,32?,34-/m0/s1 |
| InChI Key | HGABVVDKSKHSGK-AILSMDFESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H55N5O7 |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.41014911 g/mol |
| Topological Polar Surface Area (TPSA) | 145.00 Ų |
| XlogP | 5.20 |
| 560082-15-7 |
| DTXSID901046070 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.77% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.46% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.91% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.63% | 90.08% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.51% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.82% | 95.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.56% | 97.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.47% | 94.45% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.54% | 96.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.52% | 95.89% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.21% | 82.38% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.95% | 97.05% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 89.62% | 90.65% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.47% | 97.25% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.44% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.53% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.63% | 99.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.71% | 88.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.58% | 97.14% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.36% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.52% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.88% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10930574 |
| LOTUS | LTS0116243 |
| wikiData | Q75057137 |