Guanosine diphos-phate
| Internal ID | 4a948257-303c-4681-a912-f1b865793337 |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleotides > Purine ribonucleotides > Purine ribonucleoside diphosphates |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES (Canonical) | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N |
| SMILES (Isomeric) | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N |
| InChI | InChI=1S/C10H15N5O11P2/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(25-9)1-24-28(22,23)26-27(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H2,19,20,21)(H3,11,13,14,18) |
| InChI Key | QGWNDRXFNXRZMB-UHFFFAOYSA-N |
| Popularity | 1,259 references in papers |
| Molecular Formula | C10H15N5O11P2 |
| Molecular Weight | 443.20 g/mol |
| Exact Mass | 443.02433031 g/mol |
| Topological Polar Surface Area (TPSA) | 248.00 Ų |
| XlogP | -4.60 |
| 168035-01-6 |
| [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SCHEMBL37406 |
| SCHEMBL13210265 |
| BDBM82232 |
| DTXSID00861830 |
| BCP33401 |
| CAS_8977 |
| NSC_8977 |
| FT-0601270 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4105784 | P51149 | Ras-related protein Rab-7a |
25.83 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.60% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 97.63% | 80.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.98% | 95.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.03% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.53% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.82% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.32% | 97.09% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 85.18% | 97.78% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.12% | 95.64% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 83.86% | 93.53% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 83.37% | 95.48% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 82.90% | 88.84% |
| CHEMBL2094108 | P49354 | Protein farnesyltransferase | 82.39% | 97.92% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.26% | 93.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.91% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.55% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.49% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.38% | 86.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.32% | 89.34% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 80.23% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 135402030 |
| LOTUS | LTS0091599 |
| wikiData | Q105220735 |