Grincamycin D
| Internal ID | 7ac3420c-0e1f-4411-84ce-1e4c51a48007 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | (3R)-4-[6-[(1R,3R,5S,8S,10R,12R,14R)-5,14-dimethyl-6-oxo-2,4,9,13-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]-1,5-dihydroxy-9,10-dioxoanthracen-2-yl]-3-methyl-3-[(2S,5S,6S)-6-methyl-5-[(2R,6S)-6-methyl-5-oxooxan-2-yl]oxyoxan-2-yl]oxybutanoic acid |
| SMILES (Canonical) | CC1C(CCC(O1)OC(C)(CC2=C(C3=C(C=C2)C(=O)C4=C(C3=O)C=CC(=C4O)C5CC6C(C(O5)C)OC7C(O6)CC(=O)C(O7)C)O)CC(=O)O)OC8CCC(=O)C(O8)C |
| SMILES (Isomeric) | C[C@H]1[C@H](CC[C@@H](O1)O[C@](C)(CC2=C(C3=C(C=C2)C(=O)C4=C(C3=O)C=CC(=C4O)[C@H]5C[C@@H]6[C@@H]([C@H](O5)C)O[C@H]7[C@@H](O6)CC(=O)[C@@H](O7)C)O)CC(=O)O)O[C@H]8CCC(=O)[C@@H](O8)C |
| InChI | InChI=1S/C43H50O16/c1-18-26(44)10-12-33(53-18)57-28-11-13-34(54-20(28)3)59-43(5,17-32(46)47)16-22-6-7-24-35(37(22)48)39(50)25-9-8-23(38(49)36(25)40(24)51)29-15-30-41(21(4)52-29)58-42-31(56-30)14-27(45)19(2)55-42/h6-9,18-21,28-31,33-34,41-42,48-49H,10-17H2,1-5H3,(H,46,47)/t18-,19-,20-,21+,28-,29+,30+,31-,33-,34-,41+,42-,43+/m0/s1 |
| InChI Key | RTZAMMXBZUIQSH-HIAMVLHPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C43H50O16 |
| Molecular Weight | 822.80 g/mol |
| Exact Mass | 822.30988550 g/mol |
| Topological Polar Surface Area (TPSA) | 220.00 Ų |
| XlogP | 4.20 |
| (3R)-4-[6-[(1R,3R,5S,8S,10R,12R,14R)-5,14-dimethyl-6-oxo-2,4,9,13-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]-1,5-dihydroxy-9,10-dioxoanthracen-2-yl]-3-methyl-3-[(2S,5S,6S)-6-methyl-5-[(2R,6S)-6-methyl-5-oxooxan-2-yl]oxyoxan-2-yl]oxybutanoic acid |
| (3R)-4-(6-((1R,3R,5S,8S,10R,12R,14R)-5,14-dimethyl-6-oxo-2,4,9,13-tetraoxatricyclo(8.4.0.0,)tetradecan-12-yl)-1,5-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)-3-methyl-3-(((2S,5S,6S)-6-methyl-5-(((2R,6S)-6-methyl-5-oxooxan-2-yl)oxy)oxan-2-yl)oxy)butanoate |
| (3R)-4-(6-((1R,3R,5S,8S,10R,12R,14R)-5,14-dimethyl-6-oxo-2,4,9,13-tetraoxatricyclo(8.4.0.03,8)tetradecan-12-yl)-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)-3-methyl-3-((2S,5S,6S)-6-methyl-5-((2R,6S)-6-methyl-5-oxooxan-2-yl)oxyoxan-2-yl)oxybutanoic acid |
| (3R)-4-{6-[(1R,3R,5S,8S,10R,12R,14R)-5,14-dimethyl-6-oxo-2,4,9,13-tetraoxatricyclo[8.4.0.0,]tetradecan-12-yl]-1,5-dihydroxy-9,10-dioxo-9,10-dihydroanthracen-2-yl}-3-methyl-3-{[(2S,5S,6S)-6-methyl-5-{[(2R,6S)-6-methyl-5-oxooxan-2-yl]oxy}oxan-2-yl]oxy}butanoate |
| RefChem:144434 |
| CHEMBL2011812 |
| CHEBI:215167 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.47% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.53% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.84% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.17% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.91% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.86% | 95.56% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 92.66% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.38% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.16% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.09% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.37% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.12% | 90.71% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 83.86% | 94.01% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.50% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57332778 |
| LOTUS | LTS0184421 |
| wikiData | Q77562448 |