Grenadamide
| Internal ID | 1a83cbf8-fbd4-4895-8736-1f2cb14cf400 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives |
| IUPAC Name | 3-[(1S,2S)-2-heptylcyclopropyl]-N-(2-phenylethyl)propanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C21H33NO/c1-2-3-4-5-9-12-19-17-20(19)13-14-21(23)22-16-15-18-10-7-6-8-11-18/h6-8,10-11,19-20H,2-5,9,12-17H2,1H3,(H,22,23)/t19-,20-/m0/s1 |
| InChI Key | DBLLDTYDBSMYBP-PMACEKPBSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.256214676 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 6.40 |
| (+)-grenadamide |
| 205521-84-2 |
| DTXSID201046948 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.06% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.75% | 90.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.61% | 89.63% |
| CHEMBL240 | Q12809 | HERG | 95.87% | 89.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.46% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 93.82% | 96.67% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.49% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.25% | 91.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.97% | 97.79% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 90.58% | 90.24% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 88.54% | 89.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.10% | 99.23% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 85.07% | 97.64% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.55% | 96.25% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.69% | 96.95% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.89% | 85.31% |
| CHEMBL5028 | O14672 | ADAM10 | 81.55% | 97.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.51% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.24% | 86.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.71% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10710472 |
| LOTUS | LTS0137891 |
| wikiData | Q77492855 |