Gonyauline
| Internal ID | f1061bfa-3801-4612-89f5-1a2fa204f607 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Cyclopropanecarboxylic acids and derivatives > Cyclopropanecarboxylic acids |
| IUPAC Name | (1R,2R)-2-dimethylsulfoniocyclopropane-1-carboxylate |
| SMILES (Canonical) | C[S+](C)C1CC1C(=O)[O-] |
| SMILES (Isomeric) | C[S+](C)[C@@H]1C[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C6H10O2S/c1-9(2)5-3-4(5)6(7)8/h4-5H,3H2,1-2H3/t4-,5+/m0/s1 |
| InChI Key | BSFOBFUZLFYTEX-CRCLSJGQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04015073 g/mol |
| Topological Polar Surface Area (TPSA) | 41.10 Ų |
| XlogP | 1.30 |
| 125559-51-5 |
| (1R,2R)-2-dimethylsulfoniocyclopropane-1-carboxylate |
| DTXSID90154788 |
| S-Methyl-cis-2-(methylthio)cyclopropanecarboxylic acid |
| RefChem:144154 |
| DTXCID0077279 |
| (1R,2R)-2-(Dimethylsulfaniumyl)cyclopropane-1-carboxylate |
| Sulonium, (2-carboxycyclopropyl)dimethyl-, hydroxide, inner salt, (1S-cis)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.88% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.86% | 83.82% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.12% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.00% | 96.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.96% | 97.25% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.29% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.29% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3083055 |
| LOTUS | LTS0133715 |
| wikiData | Q83022113 |