Gnemonoside D
Internal ID | b5bba269-1a6f-45aa-8c0c-05cba760f099 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(E)-2-[(2S,3S)-3-(3,5-dihydroxyphenyl)-4-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=CC(=C3C(C(OC3=C2)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)OC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C2=CC(=C3[C@@H]([C@H](OC3=C2)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
InChI | InChI=1S/C34H32O11/c35-16-27-30(40)31(41)32(42)34(45-27)43-24-9-3-17(4-10-24)1-2-18-11-25(39)29-26(12-18)44-33(19-5-7-21(36)8-6-19)28(29)20-13-22(37)15-23(38)14-20/h1-15,27-28,30-42H,16H2/b2-1+/t27-,28+,30-,31+,32-,33-,34-/m1/s1 |
InChI Key | HWGLAKWMDNDFJI-HJTPYMFFSA-N |
Popularity | 3 references in papers |
Molecular Formula | C34H32O11 |
Molecular Weight | 616.60 g/mol |
Exact Mass | 616.19446183 g/mol |
Topological Polar Surface Area (TPSA) | 190.00 Ų |
XlogP | 3.60 |
CHEMBL3331579 |
SCHEMBL16736984 |
(2S,3R,4S,5S,6R)-2-[4-[(E)-2-[(2S,3S)-3-(3,5-dihydroxyphenyl)-4-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
![2D Structure of Gnemonoside D 2D Structure of Gnemonoside D](https://plantaedb.com/storage/docs/compounds/2023/11/gnemonoside-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.97% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.48% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.90% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.06% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.82% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 91.52% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.51% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.42% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.09% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.40% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.67% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.83% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.35% | 90.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.89% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.80% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 84.82% | 98.95% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.66% | 89.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.47% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.08% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gnetum gnemon |
PubChem | 21633861 |
LOTUS | LTS0126235 |
wikiData | Q105034646 |