Glycinocin C
| Internal ID | d5e8a0fb-ac00-4a85-bb32-8667becc731e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (3S)-4-[[(3S,7S,13S,16R,22S,28S)-13-butan-2-yl-22,28-bis(carboxymethyl)-16-(1-hydroxyethyl)-2,6,12,15,18,21,24,27,30,33-decaoxo-1,5,11,14,17,20,23,26,29,32-decazatricyclo[32.4.0.07,11]octatriacontan-3-yl]amino]-3-[[(E)-11-methyldodec-2-enoyl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)N2CCCC2C(=O)NCC(C(=O)N3CCCCC3C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)N1)C(C)O)CC(=O)O)CC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C=CCCCCCCCC(C)C |
| SMILES (Isomeric) | CCC(C)[C@H]1C(=O)N2CCC[C@H]2C(=O)NC[C@@H](C(=O)N3CCCCC3C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C(=O)N1)C(C)O)CC(=O)O)CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)/C=C/CCCCCCCC(C)C |
| InChI | InChI=1S/C55H86N12O19/c1-6-31(4)46-55(86)67-22-16-19-38(67)51(82)56-26-36(63-50(81)35(25-45(77)78)60-39(69)20-13-11-9-7-8-10-12-17-30(2)3)54(85)66-21-15-14-18-37(66)52(83)59-28-41(71)62-33(23-43(73)74)48(79)57-27-40(70)61-34(24-44(75)76)49(80)58-29-42(72)64-47(32(5)68)53(84)65-46/h13,20,30-38,46-47,68H,6-12,14-19,21-29H2,1-5H3,(H,56,82)(H,57,79)(H,58,80)(H,59,83)(H,60,69)(H,61,70)(H,62,71)(H,63,81)(H,64,72)(H,65,84)(H,73,74)(H,75,76)(H,77,78)/b20-13+/t31?,32?,33-,34-,35-,36-,37?,38-,46-,47+/m0/s1 |
| InChI Key | UIUDQWQRIAWKRJ-PILXTHSMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C55H86N12O19 |
| Molecular Weight | 1219.30 g/mol |
| Exact Mass | 1218.61321856 g/mol |
| Topological Polar Surface Area (TPSA) | 464.00 Ų |
| XlogP | -0.10 |
| Atomic LogP (AlogP) | -3.46 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 21 |
| CHEBI:215394 |
| (3S)-4-[[(3S,7S,13S,16R,22S,28S)-13-butan-2-yl-22,28-bis(carboxymethyl)-16-(1-hydroxyethyl)-2,6,12,15,18,21,24,27,30,33-decaoxo-1,5,11,14,17,20,23,26,29,32-decazatricyclo[32.4.0.07,11]octatriacontan-3-yl]amino]-3-[[(E)-11-methyldodec-2-enoyl]amino]-4-oxobutanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4684 | 46.84% |
| Caco-2 | - | 0.8601 | 86.01% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.5354 | 53.54% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8244 | 82.44% |
| OATP1B3 inhibitior | + | 0.9112 | 91.12% |
| MATE1 inhibitior | - | 0.9446 | 94.46% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9297 | 92.97% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8483 | 84.83% |
| CYP3A4 substrate | + | 0.7252 | 72.52% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8860 | 88.60% |
| CYP3A4 inhibition | - | 0.9676 | 96.76% |
| CYP2C9 inhibition | - | 0.9088 | 90.88% |
| CYP2C19 inhibition | - | 0.9254 | 92.54% |
| CYP2D6 inhibition | - | 0.9384 | 93.84% |
| CYP1A2 inhibition | - | 0.9469 | 94.69% |
| CYP2C8 inhibition | + | 0.6638 | 66.38% |
| CYP inhibitory promiscuity | - | 0.9777 | 97.77% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9400 | 94.00% |
| Carcinogenicity (trinary) | Non-required | 0.6110 | 61.10% |
| Eye corrosion | - | 0.9881 | 98.81% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7575 | 75.75% |
| Skin corrosion | - | 0.9066 | 90.66% |
| Ames mutagenesis | - | 0.7154 | 71.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6464 | 64.64% |
| Micronuclear | + | 0.7900 | 79.00% |
| Hepatotoxicity | - | 0.5500 | 55.00% |
| skin sensitisation | - | 0.8755 | 87.55% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | + | 0.5000 | 50.00% |
| Acute Oral Toxicity (c) | III | 0.6077 | 60.77% |
| Estrogen receptor binding | + | 0.7268 | 72.68% |
| Androgen receptor binding | + | 0.7012 | 70.12% |
| Thyroid receptor binding | + | 0.5145 | 51.45% |
| Glucocorticoid receptor binding | + | 0.6013 | 60.13% |
| Aromatase binding | + | 0.6888 | 68.88% |
| PPAR gamma | + | 0.7475 | 74.75% |
| Honey bee toxicity | - | 0.7577 | 75.77% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.8276 | 82.76% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.88% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.05% | 96.09% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 98.28% | 92.97% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 98.10% | 96.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.01% | 94.66% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.77% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.34% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.98% | 99.35% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 96.92% | 96.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.63% | 90.08% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.49% | 94.64% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.04% | 96.85% |
| CHEMBL1801 | P00747 | Plasminogen | 95.99% | 92.44% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 94.50% | 90.93% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.42% | 96.31% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.17% | 95.50% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.92% | 82.38% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.54% | 97.64% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.51% | 90.71% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 92.99% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.90% | 96.90% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.72% | 99.17% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.54% | 92.12% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.45% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.80% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.50% | 93.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.40% | 98.33% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 91.19% | 91.03% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.05% | 98.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.99% | 94.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.93% | 93.03% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.54% | 95.93% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.46% | 95.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.75% | 98.05% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.70% | 97.05% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 86.54% | 90.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.04% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.41% | 89.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.22% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.19% | 99.18% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.06% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.56% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.45% | 89.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.33% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.10% | 95.89% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.06% | 97.86% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.99% | 94.33% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 83.97% | 94.55% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.91% | 85.14% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 83.59% | 94.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.92% | 91.11% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 82.68% | 97.09% |
| CHEMBL3468 | P55210 | Caspase-7 | 82.49% | 95.68% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.65% | 95.51% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.59% | 97.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.84% | 97.09% |
| CHEMBL4633 | P22001 | Voltage-gated potassium channel subunit Kv1.3 | 80.48% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.23% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586071 |
| LOTUS | LTS0001016 |
| wikiData | Q77498162 |