Glyceryl sulfoquinovoside
Internal ID | 0cb445d2-7b2e-4463-82ee-516dcd053f04 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols |
IUPAC Name | [(2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
SMILES (Canonical) | C(C1C(C(C(C(O1)OCC(CO)O)O)O)O)S(=O)(=O)O |
SMILES (Isomeric) | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OCC(CO)O)O)O)O)S(=O)(=O)O |
InChI | InChI=1S/C9H18O10S/c10-1-4(11)2-18-9-8(14)7(13)6(12)5(19-9)3-20(15,16)17/h4-14H,1-3H2,(H,15,16,17)/t4?,5-,6-,7+,8-,9+/m1/s1 |
InChI Key | JTXHNMDHGMNPEG-TTWCUHKNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C9H18O10S |
Molecular Weight | 318.30 g/mol |
Exact Mass | 318.06206794 g/mol |
Topological Polar Surface Area (TPSA) | 182.00 Ų |
XlogP | -4.30 |
2308-53-4 |
[(2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
DTXSID30945758 |
2,3-Dihydroxypropyl 6-deoxy-6-sulfohexopyranoside |
2,3-Dihydroxypropyl 6-deoxy-6-sulfo-alpha-D-glucopyranoside |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.85% | 95.93% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.82% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.41% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 86.75% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.29% | 83.82% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.25% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.11% | 94.73% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.53% | 95.83% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.30% | 85.31% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.54% | 85.14% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.43% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium sativum |
PubChem | 192765 |
LOTUS | LTS0146582 |
wikiData | Q82923193 |