glyceollidin II
Internal ID | baf68ff4-b533-47ef-a4f7-a4f985049e49 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 2-(3-methylbut-2-enyl)-6,11a-dihydro-[1]benzofuro[3,2-c]chromene-3,6a,9-triol |
SMILES (Canonical) | CC(=CCC1=CC2=C(C=C1O)OCC3(C2OC4=C3C=CC(=C4)O)O)C |
SMILES (Isomeric) | CC(=CCC1=CC2=C(C=C1O)OCC3(C2OC4=C3C=CC(=C4)O)O)C |
InChI | InChI=1S/C20H20O5/c1-11(2)3-4-12-7-14-17(9-16(12)22)24-10-20(23)15-6-5-13(21)8-18(15)25-19(14)20/h3,5-9,19,21-23H,4,10H2,1-2H3 |
InChI Key | TUXXPRXOVFCNPC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H20O5 |
Molecular Weight | 340.40 g/mol |
Exact Mass | 340.13107373 g/mol |
Topological Polar Surface Area (TPSA) | 79.20 Ų |
XlogP | 3.10 |
CHEBI:174573 |
2-(3-Methyl-2-butenyl)-6H-benzofuro[3,2-c][1]benzopyran-3,6a,9(11aH)-triol, 9CI |
2-(3-methylbut-2-enyl)-6,11a-dihydro-[1]benzouro[3,2-c]chromene-3,6a,9-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.54% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.39% | 96.09% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.46% | 93.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.41% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.59% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.85% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.48% | 100.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.34% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.58% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.22% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.65% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.18% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.87% | 95.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.88% | 85.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.40% | 89.62% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.00% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycine max |
PubChem | 85206973 |
LOTUS | LTS0176704 |
wikiData | Q105265111 |