Glu-Met
| Internal ID | 84108cc2-a474-4007-8c22-0d9fa28fbad1 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (4S)-4-amino-5-[[(1S)-1-carboxy-3-methylsulfanylpropyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CSCCC(C(=O)O)NC(=O)C(CCC(=O)O)N |
| SMILES (Isomeric) | CSCC[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)N |
| InChI | InChI=1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-9(15)6(11)2-3-8(13)14/h6-7H,2-5,11H2,1H3,(H,12,15)(H,13,14)(H,16,17)/t6-,7-/m0/s1 |
| InChI Key | SXGAGTVDWKQYCX-BQBZGAKWSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09364285 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | -3.70 |
| H-GLU(MET)-OH |
| 4423-22-7 |
| H-Glu-Met-OH |
| glutamyl-methionine |
| L-Glutamyl-L-Methionine |
| L-alpha-glutamyl-L-methionine |
| Glutamylmethionine |
| (4S)-4-amino-5-[[(1S)-1-carboxy-3-methylsulfanylpropyl]amino]-5-oxopentanoic acid |
| EM dipeptide |
| E-M Dipeptide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.33% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.36% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.07% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.36% | 99.35% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.75% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.46% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.55% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.61% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.84% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.95% | 98.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.84% | 91.19% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.69% | 97.21% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.04% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.34% | 96.95% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.05% | 96.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.60% | 93.10% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.53% | 96.03% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 82.32% | 93.33% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.60% | 89.50% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.54% | 97.06% |
| CHEMBL3308 | P55212 | Caspase-6 | 80.47% | 97.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.36% | 94.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.32% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6426949 |
| LOTUS | LTS0137401 |
| wikiData | Q27140587 |