Glu-Leu
| Internal ID | 9645ca6b-e13d-4df0-b877-222f6a54214e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)O)NC(=O)C(CCC(=O)O)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)N |
| InChI | InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-10(16)7(12)3-4-9(14)15/h6-8H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t7-,8-/m0/s1 |
| InChI Key | YBAFDPFAUTYYRW-YUMQZZPRSA-N |
| Popularity | 17 references in papers |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13722174 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | -3.30 |
| L-Glutamyl-L-Leucine |
| CHEBI:73506 |
| H-Glu-Leu-OH |
| glutamylleucine |
| glutamyl-leucine |
| EL dipeptide |
| E-L Dipeptide |
| glutamyl-l-leucine |
| Glu(Leu) |
| L-Glu-L-Leu |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.03% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.45% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.05% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.07% | 93.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.84% | 99.35% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 94.40% | 92.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.45% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 91.21% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.12% | 90.20% |
| CHEMBL3837 | P07711 | Cathepsin L | 89.61% | 96.61% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.02% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.93% | 96.47% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.18% | 98.10% |
| CHEMBL3776 | Q14790 | Caspase-8 | 86.52% | 97.06% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.13% | 98.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.48% | 93.10% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.78% | 91.19% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.78% | 100.00% |
| CHEMBL3308 | P55212 | Caspase-6 | 84.49% | 97.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.28% | 96.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.70% | 98.05% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.66% | 96.03% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.42% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.16% | 97.21% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.97% | 89.50% |
| CHEMBL268 | P43235 | Cathepsin K | 82.31% | 96.85% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.14% | 93.31% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.03% | 90.71% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.97% | 97.86% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.15% | 94.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 81.14% | 92.80% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 80.39% | 92.26% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9856500 |
| LOTUS | LTS0222910 |
| wikiData | Q27140586 |