Glu-Glu-Gly
| Internal ID | 6f43207a-bbfb-40b0-b520-8f8d64559e59 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (4S)-4-amino-5-[[(2S)-4-carboxy-1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H19N3O8/c13-6(1-3-8(16)17)11(22)15-7(2-4-9(18)19)12(23)14-5-10(20)21/h6-7H,1-5,13H2,(H,14,23)(H,15,22)(H,16,17)(H,18,19)(H,20,21)/t6-,7-/m0/s1 |
| InChI Key | SJPMNHCEWPTRBR-BQBZGAKWSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C12H19N3O8 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11721457 g/mol |
| Topological Polar Surface Area (TPSA) | 196.00 Ų |
| XlogP | -4.90 |
| L-Glu-L-Glu-L-Gly |
| E-E-G |
| L-Glutamyl-L-glutamyl-glycine |
| CHEBI:73494 |
| L-alpha-glutamyl-L-alpha-glutamylglycine |
| (4S)-4-amino-5-(((2S)-4-carboxy-1-(carboxymethylamino)-1-oxobutan-2-yl)amino)-5-oxopentanoic acid |
| (4S)-4-amino-5-[[(2S)-4-carboxy-1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| RefChem:143545 |
| Glutamyl-glutamyl-glycine |
| SCHEMBL29384215 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.79% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.05% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.49% | 98.95% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.35% | 99.35% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.85% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.84% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.10% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.08% | 91.19% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 88.75% | 96.28% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.70% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.57% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.13% | 93.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.88% | 97.21% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.45% | 96.03% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.00% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.24% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.50% | 98.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.67% | 96.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.55% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.51% | 91.11% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.43% | 98.24% |
| CHEMBL3308 | P55212 | Caspase-6 | 81.09% | 97.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.89% | 98.05% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 80.69% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 86289106 |
| LOTUS | LTS0210504 |
| wikiData | Q27140572 |