Glaucamine
| Internal ID | 66cb179e-13f4-447a-a1f1-0452eb2ac39b |
| Taxonomy | Alkaloids and derivatives > Rhoeadine alkaloids |
| IUPAC Name | 16,17-dimethoxy-22-methyl-6,8,12-trioxa-22-azapentacyclo[11.9.0.02,10.05,9.014,19]docosa-2(10),3,5(9),14,16,18-hexaen-11-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C=C2C3C1C4=C(C(O3)O)C5=C(C=C4)OCO5)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C=C2C3C1C4=C(C(O3)O)C5=C(C=C4)OCO5)OC)OC |
| InChI | InChI=1S/C21H23NO6/c1-22-7-6-11-8-15(24-2)16(25-3)9-13(11)19-18(22)12-4-5-14-20(27-10-26-14)17(12)21(23)28-19/h4-5,8-9,18-19,21,23H,6-7,10H2,1-3H3 |
| InChI Key | XYWRZQQANNOTTD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.15253745 g/mol |
| Topological Polar Surface Area (TPSA) | 69.60 Ų |
| XlogP | 2.00 |
| Alkaloid R-L |
| XYWRZQQANNOTTD-UHFFFAOYSA-N |
| 2,3-Dimethoxy-16-methyl-10,11-[methylenebis(oxy)]rheadan-8-ol, 9CI |
| 1,3-Dioxolo[7,8][2]benzopyrano[3,4-a][3]benzazepine, rheadan-8-ol deriv. |
| Rheadan-8-ol, 2,3-dimethoxy-16-methyl-10,11-[methylenebis(oxy)]-, (6.alpha.,8.alpha.)- |
| 10,11-Dimethoxy-6-methyl-5b,6,7,8,12b,14-hexahydro[1,3]dioxolo[4',5':7,8]isochromeno[3,4-a][3]benzazepin-14-ol # |
| 16,17-dimethoxy-22-methyl-6,8,12-trioxa-22-azapentacyclo[11.9.0.0^{2,10}.0^{5,9}.0^{14,19}]docosa-2,4,9,14(19),15,17-hexaen-11-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.11% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.21% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.49% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.04% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.44% | 96.77% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 92.48% | 82.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.12% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.82% | 93.99% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.66% | 93.40% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.43% | 92.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.37% | 91.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.09% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.98% | 95.89% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.46% | 89.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.71% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.25% | 98.75% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 84.11% | 90.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.67% | 92.94% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.54% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.11% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.77% | 90.00% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 81.54% | 91.96% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.34% | 96.39% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.18% | 97.14% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.04% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Papaver glaucum |
| Papaver persicum subsp. tauricola |
| Papaver rhoeas |
| PubChem | 609842 |
| LOTUS | LTS0081719 |
| wikiData | Q105344722 |