ginsenoside R10
Internal ID | 0d081e24-7d69-4fbf-bd82-d04b769d6204 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-17-[(2S,5R)-5-hydroxy-2,6,6-trimethyloxan-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1(C(CCC2(C1C(CC3(C2CC(C4C3(CCC4C5(CCC(C(O5)(C)C)O)C)C)O)C)OC6C(C(C(C(O6)CO)O)O)O)C)O)C |
SMILES (Isomeric) | C[C@]1(CC[C@H](C(O1)(C)C)O)[C@H]2CC[C@@]3([C@@H]2[C@@H](C[C@H]4[C@]3(C[C@@H]([C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)O)C |
InChI | InChI=1S/C36H62O10/c1-31(2)23(39)10-12-33(5)22-15-19(38)25-18(36(8)14-11-24(40)32(3,4)46-36)9-13-34(25,6)35(22,7)16-20(29(31)33)44-30-28(43)27(42)26(41)21(17-37)45-30/h18-30,37-43H,9-17H2,1-8H3/t18-,19+,20-,21+,22+,23-,24+,25-,26+,27-,28+,29-,30+,33+,34+,35+,36-/m0/s1 |
InChI Key | CFOKFXFKMQABRM-JLXGCTMESA-N |
Popularity | 2 references in papers |
Molecular Formula | C36H62O10 |
Molecular Weight | 654.90 g/mol |
Exact Mass | 654.43429817 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 3.00 |
CHEMBL509099 |
DTXSID601135426 |
(3beta,6alpha,12beta,24R)-20,25-Epoxy-3,12,24-trihydroxydammaran-6-yl beta-D-glucopyranoside |
156398-69-5 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.72% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.53% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.49% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.59% | 95.93% |
CHEMBL220 | P22303 | Acetylcholinesterase | 91.77% | 94.45% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 91.36% | 95.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.63% | 97.79% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.67% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.57% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.75% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.01% | 92.98% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.34% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.75% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.64% | 95.50% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.35% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 84.14% | 96.43% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.61% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.56% | 86.33% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 82.56% | 96.03% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.33% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.01% | 90.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.85% | 92.94% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.37% | 95.58% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.10% | 100.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.13% | 95.38% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.00% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax vietnamensis |
PubChem | 44584745 |
LOTUS | LTS0259121 |
wikiData | Q104956832 |