Gibbilimbol A
Internal ID | da2683cd-1eb4-42e7-9f3d-fe845d7e33c7 |
Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
IUPAC Name | 4-[(E)-dec-4-enyl]phenol |
SMILES (Canonical) | CCCCCC=CCCCC1=CC=C(C=C1)O |
SMILES (Isomeric) | CCCCC/C=C/CCCC1=CC=C(C=C1)O |
InChI | InChI=1S/C16H24O/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15/h6-7,11-14,17H,2-5,8-10H2,1H3/b7-6+ |
InChI Key | LMJPVRXXPPOFAM-VOTSOKGWSA-N |
Popularity | 5 references in papers |
Molecular Formula | C16H24O |
Molecular Weight | 232.36 g/mol |
Exact Mass | 232.182715385 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 5.80 |
4-[(E)-dec-4-enyl]phenol |
CHEMBL503936 |
LMJPVRXXPPOFAM-VOTSOKGWSA-N |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.77% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.03% | 99.17% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.28% | 98.35% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.24% | 92.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.16% | 96.09% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.62% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.28% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.84% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.38% | 94.45% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.28% | 91.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.27% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.06% | 94.73% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 83.53% | 94.01% |
CHEMBL240 | Q12809 | HERG | 83.05% | 89.76% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.76% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper gibbilimbum |
PubChem | 10263365 |
LOTUS | LTS0083842 |
wikiData | Q104251553 |