Genistein, O,O'-bis(acetyl)-
| Internal ID | b12cef4c-4565-4149-b201-f8c3404fb481 |
| Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
| IUPAC Name | [4-(7-acetyloxy-5-hydroxy-4-oxochromen-3-yl)phenyl] acetate |
| SMILES (Canonical) | CC(=O)OC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)OC(=O)C |
| SMILES (Isomeric) | CC(=O)OC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)OC(=O)C |
| InChI | InChI=1S/C19H14O7/c1-10(20)25-13-5-3-12(4-6-13)15-9-24-17-8-14(26-11(2)21)7-16(22)18(17)19(15)23/h3-9,22H,1-2H3 |
| InChI Key | LANSIWZTDAKDFI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.07395278 g/mol |
| Topological Polar Surface Area (TPSA) | 99.10 Ų |
| XlogP | 2.90 |
| CHEMBL2261220 |
| Genistein, O,O'-bis(acetyl)- |
| LANSIWZTDAKDFI-UHFFFAOYSA-N |
| DTXSID601156769 |
| 4',7-DIACETOXY-5-HYDROXYGENISTEIN |
| 4-[7-(Acetyloxy)-5-hydroxy-4-oxo-4H-1-benzopyran-3-yl]phenyl acetate |
| 7-(Acetyloxy)-3-[4-(acetyloxy)phenyl]-5-hydroxy-4H-1-benzopyran-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.64% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.71% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.93% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.25% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.99% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.48% | 95.56% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.29% | 95.78% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.21% | 97.28% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.72% | 96.12% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.13% | 86.92% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.04% | 90.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.95% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.64% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.49% | 90.71% |
| CHEMBL3194 | P02766 | Transthyretin | 82.01% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.05% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Laburnum alpinum |
| PubChem | 12109569 |
| LOTUS | LTS0206366 |
| wikiData | Q105148773 |