Geiparvarin
Internal ID | 56b8ad99-8df3-4253-90ac-fe447d20cea1 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enoxy]chromen-2-one |
SMILES (Canonical) | CC(=CCOC1=CC2=C(C=C1)C=CC(=O)O2)C3=CC(=O)C(O3)(C)C |
SMILES (Isomeric) | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/C3=CC(=O)C(O3)(C)C |
InChI | InChI=1S/C19H18O5/c1-12(15-11-17(20)19(2,3)24-15)8-9-22-14-6-4-13-5-7-18(21)23-16(13)10-14/h4-8,10-11H,9H2,1-3H3/b12-8+ |
InChI Key | OUTLLBZGJYDUQE-XYOKQWHBSA-N |
Popularity | 18 references in papers |
Molecular Formula | C19H18O5 |
Molecular Weight | 326.30 g/mol |
Exact Mass | 326.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 61.80 Ų |
XlogP | 3.40 |
36413-91-9 |
GEIPARVIN |
O0M5JB2L95 |
NSC-142227 |
MLS002920544 |
UNII-O0M5JB2L95 |
NSC142227 |
NSC 142227 |
7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)but-2-enoxy]chromen-2-one |
CHEMBL56918 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
600 nM |
Ki |
via Super-PRED
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
830 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.93% | 91.11% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 97.90% | 92.51% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.73% | 94.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.67% | 94.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.54% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 92.51% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.99% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.52% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.90% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.55% | 90.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.08% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.42% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.13% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.82% | 96.00% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.32% | 89.67% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.87% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Geijera parviflora |
PubChem | 5910585 |
LOTUS | LTS0019425 |
wikiData | Q5530160 |