Garcibiphenyl C
| Internal ID | 6f382242-0970-4fc2-bcbe-d36e99ce0d8b |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenols |
| IUPAC Name | 4-(4-hydroxyphenyl)-2,6-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2=CC=C(C=C2)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C14H14O4/c1-17-12-7-10(8-13(18-2)14(12)16)9-3-5-11(15)6-4-9/h3-8,15-16H,1-2H3 |
| InChI Key | KMMVLPSUFLSVAH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 2.80 |
| 4-(4-hydroxyphenyl)-2,6-dimethoxy-phenol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.79% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.73% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 89.97% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.17% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.02% | 94.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.03% | 88.48% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.03% | 98.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.56% | 92.94% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 84.52% | 89.32% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.77% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.67% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.79% | 93.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.55% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.50% | 85.14% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 80.21% | 97.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia linii |
| Podophyllum peltatum |
| PubChem | 134817091 |
| LOTUS | LTS0049370 |
| wikiData | Q105169616 |