Ganoderic acid U
Internal ID | 82db6ea8-9c8f-48ba-a627-b1058c9389fa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (E,6R)-6-[(3R,5R,7R,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
SMILES (Canonical) | CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC3=C2C(CC4C3(CCC(C4(C)C)O)C)O)C)C |
SMILES (Isomeric) | C[C@H](CC/C=C(\C)/C(=O)O)[C@H]1CC[C@@]2([C@@]1(CCC3=C2[C@@H](C[C@@H]4[C@@]3(CC[C@H](C4(C)C)O)C)O)C)C |
InChI | InChI=1S/C30H48O4/c1-18(9-8-10-19(2)26(33)34)20-11-16-30(7)25-21(12-15-29(20,30)6)28(5)14-13-24(32)27(3,4)23(28)17-22(25)31/h10,18,20,22-24,31-32H,8-9,11-17H2,1-7H3,(H,33,34)/b19-10+/t18-,20-,22-,23+,24-,28-,29-,30+/m1/s1 |
InChI Key | QHLHTTNIUVMWRY-BMGHSXGVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O4 |
Molecular Weight | 472.70 g/mol |
Exact Mass | 472.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 6.30 |
86377-51-7 |
CHEBI:175722 |
DTXSID601210042 |
(3alpha,7alpha,24E)-3,7-Dihydroxylanosta-8,24-dien-26-oic acid |
(E,6R)-6-[(3R,5R,7R,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.45% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.07% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.83% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.75% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.27% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.08% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.54% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.60% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.98% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.87% | 100.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.41% | 95.50% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.60% | 96.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.25% | 93.56% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.64% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.74% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.24% | 89.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.18% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schisandra chinensis |
PubChem | 101600072 |
LOTUS | LTS0080987 |
wikiData | Q105220995 |