Ganocin B
| Internal ID | 944e75d2-fa8a-4d4e-85b8-4cb0fad938c4 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
| IUPAC Name | (1R,2R,5R)-10-hydroxy-5-methyl-2-prop-1-en-2-yl-6-oxatetracyclo[11.4.0.01,5.07,12]heptadeca-7(12),8,10,13-tetraen-15-one |
| SMILES (Canonical) | CC(=C)C1CCC2(C13CCC(=O)C=C3C4=C(O2)C=CC(=C4)O)C |
| SMILES (Isomeric) | CC(=C)[C@H]1CC[C@@]2([C@]13CCC(=O)C=C3C4=C(O2)C=CC(=C4)O)C |
| InChI | InChI=1S/C20H22O3/c1-12(2)16-7-8-19(3)20(16)9-6-14(22)11-17(20)15-10-13(21)4-5-18(15)23-19/h4-5,10-11,16,21H,1,6-9H2,2-3H3/t16-,19-,20-/m1/s1 |
| InChI Key | BHISOVHYFGGJLO-NSISKUIASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 3.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.82% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.44% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.65% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.54% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.46% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.13% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.61% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.81% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.05% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.22% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.51% | 99.23% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.50% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.53% | 95.89% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.44% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.34% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.77% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.53% | 92.94% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.07% | 85.49% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.31% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585737 |
| LOTUS | LTS0156371 |
| wikiData | Q77490557 |