gamma-L-Glutamyl-butirosin B
| Internal ID | 0524fbb4-8449-4f78-acb0-e3e35fca3138 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > 2-deoxystreptamine aminoglycosides > 4,5-disubstituted 2-deoxystreptamines |
| IUPAC Name | (2S)-2-amino-5-[[(3S)-4-[[(1R,2S,3R,4R,5S)-5-amino-4-[(2R,3R,4R,5S,6R)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxycyclohexyl]amino]-3-hydroxy-4-oxobutyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | C1C(C(C(C(C1NC(=O)C(CCNC(=O)CCC(C(=O)O)N)O)O)OC2C(C(C(O2)CO)O)O)OC3C(C(C(C(O3)CN)O)O)N)N |
| SMILES (Isomeric) | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCNC(=O)CC[C@@H](C(=O)O)N)O)O)O[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)N)N |
| InChI | InChI=1S/C26H48N6O15/c27-6-12-17(37)19(39)15(30)25(44-12)46-21-9(29)5-10(16(36)22(21)47-26-20(40)18(38)13(7-33)45-26)32-23(41)11(34)3-4-31-14(35)2-1-8(28)24(42)43/h8-13,15-22,25-26,33-34,36-40H,1-7,27-30H2,(H,31,35)(H,32,41)(H,42,43)/t8-,9-,10+,11-,12+,13+,15+,16-,17+,18+,19+,20+,21+,22+,25+,26-/m0/s1 |
| InChI Key | YGLNWHGPOZHVMV-BHZFYAMWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H48N6O15 |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.31776485 g/mol |
| Topological Polar Surface Area (TPSA) | 378.00 Ų |
| XlogP | -10.30 |
| Atomic LogP (AlogP) | -8.44 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 15 |
| gamma-L-Glutamyl-butirosin B |
| CHEBI:65108 |
| (1R,2R,3S,4R,6S)-6-amino-4-{[(2S)-4-(L-gamma-glutamylamino)-2-hydroxybutanoyl]amino}-3-hydroxy-2-(beta-D-ribofuranosyloxy)cyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside |
| (1R,2R,3S,4R,6S)-6-amino-4-(((2S)-4-(L-gamma-glutamylamino)-2-hydroxybutanoyl)amino)-3-hydroxy-2-(beta-D-ribofuranosyloxy)cyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside |
| (2S)-2-amino-5-(((3S)-4-(((1R,2S,3R,4R,5S)-5-amino-4-((2R,3R,4R,5S,6R)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl)oxy-3-((2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl)oxy-2-hydroxycyclohexyl)amino)-3-hydroxy-4-oxobutyl)amino)-5-oxopentanoic acid |
| (2S)-2-amino-5-[[(3S)-4-[[(1R,2S,3R,4R,5S)-5-amino-4-[(2R,3R,4R,5S,6R)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxycyclohexyl]amino]-3-hydroxy-4-oxobutyl]amino]-5-oxopentanoic acid |
| RefChem:142345 |
| 4-glutamyl-(S)-2-hydroxy-4-aminobutanoyl-ribostamycin |
| C18005 |
| Q27133657 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.9550 | 95.50% |
| Caco-2 | - | 0.8790 | 87.90% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.8571 | 85.71% |
| Subcellular localzation | Mitochondria | 0.4584 | 45.84% |
| OATP2B1 inhibitior | - | 0.5810 | 58.10% |
| OATP1B1 inhibitior | + | 0.8944 | 89.44% |
| OATP1B3 inhibitior | + | 0.9453 | 94.53% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | - | 0.7925 | 79.25% |
| P-glycoprotein inhibitior | + | 0.5937 | 59.37% |
| P-glycoprotein substrate | - | 0.5406 | 54.06% |
| CYP3A4 substrate | + | 0.6678 | 66.78% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8387 | 83.87% |
| CYP3A4 inhibition | - | 0.9391 | 93.91% |
| CYP2C9 inhibition | - | 0.9493 | 94.93% |
| CYP2C19 inhibition | - | 0.9247 | 92.47% |
| CYP2D6 inhibition | - | 0.9311 | 93.11% |
| CYP1A2 inhibition | - | 0.9412 | 94.12% |
| CYP2C8 inhibition | + | 0.5297 | 52.97% |
| CYP inhibitory promiscuity | - | 0.9190 | 91.90% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.6794 | 67.94% |
| Eye corrosion | - | 0.9881 | 98.81% |
| Eye irritation | - | 0.9213 | 92.13% |
| Skin irritation | - | 0.7878 | 78.78% |
| Skin corrosion | - | 0.9350 | 93.50% |
| Ames mutagenesis | - | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4165 | 41.65% |
| Micronuclear | + | 0.7300 | 73.00% |
| Hepatotoxicity | - | 0.5162 | 51.62% |
| skin sensitisation | - | 0.9099 | 90.99% |
| Respiratory toxicity | + | 0.7000 | 70.00% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | - | 0.7458 | 74.58% |
| Acute Oral Toxicity (c) | III | 0.4717 | 47.17% |
| Estrogen receptor binding | + | 0.6783 | 67.83% |
| Androgen receptor binding | + | 0.5425 | 54.25% |
| Thyroid receptor binding | - | 0.5356 | 53.56% |
| Glucocorticoid receptor binding | + | 0.6011 | 60.11% |
| Aromatase binding | + | 0.6763 | 67.63% |
| PPAR gamma | + | 0.6460 | 64.60% |
| Honey bee toxicity | - | 0.6954 | 69.54% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | - | 0.6900 | 69.00% |
| Fish aquatic toxicity | - | 0.8319 | 83.19% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.44% | 91.11% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.87% | 95.58% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.46% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.85% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.56% | 97.09% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.54% | 98.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.10% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.35% | 92.29% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 90.41% | 82.86% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.66% | 96.95% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.57% | 96.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.00% | 93.10% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 87.84% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.11% | 94.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.10% | 91.19% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.98% | 96.21% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.50% | 90.17% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 86.32% | 96.28% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.29% | 95.93% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 85.71% | 91.83% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.50% | 92.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.23% | 100.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.62% | 91.24% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.39% | 94.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.63% | 95.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.58% | 96.47% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.51% | 97.29% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.30% | 92.32% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.11% | 94.45% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 82.95% | 88.42% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.88% | 90.71% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.67% | 96.77% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.44% | 89.50% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.61% | 97.93% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.64% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.24% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46174033 |
| LOTUS | LTS0098160 |
| wikiData | Q27133657 |