gamma-Glutamylvaline
| Internal ID | 5ecbbc29-0d6f-417e-8c97-e34879f3e42a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-amino-5-[[(1S)-1-carboxy-2-methylpropyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CC(C)C(C(=O)O)NC(=O)CCC(C(=O)O)N |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-7(13)4-3-6(11)9(14)15/h5-6,8H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17)/t6-,8-/m0/s1 |
| InChI Key | AQAKHZVPOOGUCK-XPUUQOCRSA-N |
| Popularity | 44 references in papers |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12157168 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | -2.80 |
| g-Glu-Val |
| 2746-34-1 |
| gamma-Glu-Val |
| H-Glu(Val-OH)-OH |
| L-gamma-Glu-L-Val |
| H-gamma-Glu-Val-OH |
| L-gamma-glutamyl-L-valine |
| (2S)-2-Amino-5-[[(1S)-1-carboxy-2-methylpropyl]amino]-5-oxopentanoic acid |
| (2S)-2-amino-5-{[(1S)-1-carboxy-2-methylpropyl]amino}-5-oxopentanoic acid |
| gamma-Glutamyl-valine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.05% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.00% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.60% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.78% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.11% | 92.29% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.15% | 90.24% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.81% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.82% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.18% | 89.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.56% | 94.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.37% | 93.56% |
| CHEMBL3308 | P55212 | Caspase-6 | 83.97% | 97.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.99% | 99.35% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.62% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.58% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.10% | 94.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.48% | 94.33% |
| CHEMBL3776 | Q14790 | Caspase-8 | 80.41% | 97.06% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phaseolus vulgaris |
| PubChem | 7015683 |
| LOTUS | LTS0158657 |
| wikiData | Q27137212 |