gamma-Glutamylmethionine sulfoximine
| Internal ID | 9e7fce0e-71f0-4f4a-9864-e1da86460f30 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-amino-5-[[(1S)-1-carboxy-3-(methylsulfonimidoyl)propyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CS(=N)(=O)CCC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| SMILES (Isomeric) | CS(=N)(=O)CC[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| InChI | InChI=1S/C10H19N3O6S/c1-20(12,19)5-4-7(10(17)18)13-8(14)3-2-6(11)9(15)16/h6-7,12H,2-5,11H2,1H3,(H,13,14)(H,15,16)(H,17,18)/t6-,7-,20?/m0/s1 |
| InChI Key | NPPALQSPDYMHBI-ICZSOJPRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H19N3O6S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.09945651 g/mol |
| Topological Polar Surface Area (TPSA) | 179.00 Ų |
| XlogP | -3.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 97.96% | 92.29% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.97% | 95.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.40% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.25% | 96.09% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.15% | 99.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.86% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.16% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.08% | 91.19% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.88% | 96.95% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 86.70% | 93.53% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.38% | 97.21% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.14% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.10% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.09% | 93.10% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.36% | 90.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.11% | 94.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.05% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.05% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.90% | 93.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 81.18% | 96.03% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.07% | 89.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.17% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.06% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pinus taeda |
| PubChem | 139584790 |
| LOTUS | LTS0129473 |
| wikiData | Q105190296 |