galphimine G
| Internal ID | 75a2bae0-c482-413f-931b-2603ac5a4837 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Hydroxysteroids |
| IUPAC Name | methyl (1S,2R,5R,10S,11S,14S,15S,21R,22R,23S)-22-acetyloxy-10,23-dihydroxy-21-[(1R)-1-hydroxyethyl]-2,5,14-trimethyl-8-methylidene-18-oxo-19-oxapentacyclo[12.9.0.02,11.05,10.015,21]tricos-16-ene-11-carboxylate |
| SMILES (Canonical) | CC(C12COC(=O)C=CC1C3(CCC4(C(C3C(C2OC(=O)C)O)(CCC5(C4(CC(=C)CC5)O)C)C)C(=O)OC)C)O |
| SMILES (Isomeric) | C[C@H]([C@]12COC(=O)C=C[C@H]1[C@@]3(CC[C@@]4([C@@]([C@H]3[C@@H]([C@@H]2OC(=O)C)O)(CC[C@@]5([C@]4(CC(=C)CC5)O)C)C)C(=O)OC)C)O |
| InChI | InChI=1S/C32H46O9/c1-18-10-11-27(4)12-14-29(6)24-23(36)25(41-20(3)34)30(19(2)33)17-40-22(35)9-8-21(30)28(24,5)13-15-31(29,26(37)39-7)32(27,38)16-18/h8-9,19,21,23-25,33,36,38H,1,10-17H2,2-7H3/t19-,21+,23+,24+,25+,27-,28+,29-,30-,31+,32+/m1/s1 |
| InChI Key | DFTOCERTSAMQSM-STODXTIPSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H46O9 |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.31418304 g/mol |
| Topological Polar Surface Area (TPSA) | 140.00 Ų |
| XlogP | 3.60 |
| CHEMBL509043 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.91% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.89% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.48% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.64% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.26% | 97.25% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.19% | 96.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.07% | 96.77% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.96% | 95.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.49% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.85% | 91.07% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.72% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.65% | 89.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.17% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.07% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.64% | 95.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.47% | 98.75% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 85.55% | 82.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.48% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.17% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.60% | 97.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.93% | 91.19% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.56% | 92.62% |
| CHEMBL5028 | O14672 | ADAM10 | 82.90% | 97.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.80% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.24% | 94.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.37% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.73% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Galphimia glauca |
| PubChem | 21578023 |
| LOTUS | LTS0228283 |
| wikiData | Q103813543 |