galloyl(-3)Glc(b)-O-galloyl
Internal ID | 946f87bc-1a22-4ece-b527-62dec9b335fa |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-(3,4,5-trihydroxybenzoyl)oxyoxan-4-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(OC(C2O)OC(=O)C3=CC(=C(C(=C3)O)O)O)CO)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O[C@H]2[C@@H]([C@H](O[C@H]([C@@H]2O)OC(=O)C3=CC(=C(C(=C3)O)O)O)CO)O |
InChI | InChI=1S/C20H20O14/c21-5-12-15(28)17(33-18(30)6-1-8(22)13(26)9(23)2-6)16(29)20(32-12)34-19(31)7-3-10(24)14(27)11(25)4-7/h1-4,12,15-17,20-29H,5H2/t12-,15-,16-,17+,20+/m1/s1 |
InChI Key | BCPWVGJXNJHLKX-KKFGISDUSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H20O14 |
Molecular Weight | 484.40 g/mol |
Exact Mass | 484.08530531 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.84% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.70% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.17% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.91% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.16% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.14% | 83.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.02% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.78% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.31% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 85.30% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.02% | 86.92% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.73% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Balanophora harlandii |
Balanophora japonica |
Balanophora laxiflora |
Camellia crassicolumna |
Falconeria insignis |
PubChem | 11027295 |
LOTUS | LTS0096109 |
wikiData | Q104923571 |