galloyl(-2)[galloyl(-6)]Hex-O-Ph(4-OH)
| Internal ID | 73477cc6-0d17-4f06-bed7-533513a1c71a |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | [3,4-dihydroxy-6-(4-hydroxyphenoxy)-5-(3,4,5-trihydroxybenzoyl)oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
| SMILES (Canonical) | C1=CC(=CC=C1O)OC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1O)OC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O |
| InChI | InChI=1S/C26H24O15/c27-12-1-3-13(4-2-12)39-26-23(41-25(37)11-7-16(30)20(33)17(31)8-11)22(35)21(34)18(40-26)9-38-24(36)10-5-14(28)19(32)15(29)6-10/h1-8,18,21-23,26-35H,9H2 |
| InChI Key | QACZCPQDYIUXRV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H24O15 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.11152005 g/mol |
| Topological Polar Surface Area (TPSA) | 253.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
![2D Structure of galloyl(-2)[galloyl(-6)]Hex-O-Ph(4-OH)](https://plantaedb.com/storage/docs/compounds/2023/11/galloyl-2galloyl-6hex-o-ph4-oh.jpg "2D Structure of galloyl(-2)[galloyl(-6)]Hex-O-Ph(4-OH)")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.43% | 95.64% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.44% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.51% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 93.93% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.32% | 90.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.22% | 83.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.27% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.59% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.18% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 89.71% | 95.93% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.45% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.52% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.52% | 99.15% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.26% | 97.21% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.21% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.13% | 89.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.93% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.68% | 96.95% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.30% | 85.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.70% | 92.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.92% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.59% | 98.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.12% | 91.07% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.08% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eugenia hyemalis |
| Phedimus kamtschaticus |
| PubChem | 74071829 |
| LOTUS | LTS0082500 |
| wikiData | Q105217336 |