Gal(a1-4)Man(a1-4)b-Kdo
| Internal ID | a41b3f56-984d-425d-a094-4f85d2d89196 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
| IUPAC Name | (2S,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4-[(2S,3S,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,5-dihydroxyoxane-2-carboxylic acid |
| SMILES (Canonical) | C1C(C(C(OC1(C(=O)O)O)C(CO)O)O)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@H]([C@H]([C@H](O[C@@]1(C(=O)O)O)[C@@H](CO)O)O)O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O[C@@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O |
| InChI | InChI=1S/C20H34O18/c21-2-5(24)15-10(26)6(1-20(33,38-15)19(31)32)34-17-14(30)12(28)16(8(4-23)36-17)37-18-13(29)11(27)9(25)7(3-22)35-18/h5-18,21-30,33H,1-4H2,(H,31,32)/t5-,6-,7-,8-,9+,10-,11+,12-,13-,14+,15-,16-,17+,18-,20+/m1/s1 |
| InChI Key | YCNWLQNQAGABDQ-FJRKJVRLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O18 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.17451423 g/mol |
| Topological Polar Surface Area (TPSA) | 306.00 Ų |
| XlogP | -6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.33% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.47% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.21% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.33% | 83.82% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.64% | 92.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.50% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.18% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.57% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.09% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.92% | 85.14% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.89% | 96.95% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.58% | 91.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.98% | 98.95% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.64% | 92.32% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.75% | 92.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.66% | 100.00% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.35% | 92.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163026919 |
| LOTUS | LTS0198308 |
| wikiData | Q105346374 |